To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 741 | Scequinadoline b | C27H29N5O4 |
487.50 g/mol |
CC(C)C1C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CC4(C5NC(C(=O)N5C6=CC=CC=C64)(C)C)O |
| 742 | Scequinadoline g | C23H22N4O3 |
402.40 g/mol |
CC(=C1C2=NC3=CC=CC=C3C(=O)N2C(CN1)CC4(C5=CC=CC=C5NC4=O)O)C |
| 743 | Sch 725680 | C21H22O7 |
386.40 g/mol |
CC=CC1=CC2=CC(=O)C(C(C2CO1)OC(=O)C3=C(C=C(C=C3C)O)O)(C)O |
| 744 | Scirpentriol | C15H22O5 |
282.33 g/mol |
CC1=CC2C(CC1)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| 745 | Sclerotiorin | C21H23ClO5 |
390.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C(C(=O)C2=CO1)(C)OC(=O)C)Cl |
| 746 | Secalonic acid b | C32H30O14 |
638.60 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)OC6(C(C(CC(=O)C6=C5O)C)O)C(=O)OC)O)OC2(C1O)C(=O)OC)O |
| 747 | Secalonic acid d | C32H30O14 |
638.60 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)OC6(C(C(CC(=O)C6=C5O)C)O)C(=O)OC)O)OC2(C1O)C(=O)OC)O |
| 748 | Secalonic acid f | C32H30O14 |
638.60 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C(C5=C(C=C4)OC6(C(C(CC(=O)C6=C5O)C)O)C(=O)OC)O)OC2(C1O)C(=O)OC)O |
| 749 | Secoemestrin c | C27H22N2O10S4 |
662.70 g/mol |
CN1C2C(=O)N3C4C(C=COC=C4C(C3(C1=O)SSSS2)O)OC(=O)C5=CC(=C(C=C5)OC)OC6=C(C=CC(=C6)C=O)O |
| 750 | Semi xanthomegnin | C15H12O6 |
288.25 g/mol |
CC1CC2=CC3=C(C(=O)C=C(C3=O)OC)C(=C2C(=O)O1)O |