To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 751 | Serantrypinone | C21H16N4O4 |
388.40 g/mol |
C1C2C(=O)NC(C13C4=CC=CC=C4NC3=O)(C5=NC6=CC=CC=C6C(=O)N25)CO |
| 752 | Shamixanthone | C25H26O5 |
406.50 g/mol |
CC1=CC2=C(C3=C1OCC(C3O)C(=C)C)C(=O)C4=C(C=CC(=C4O2)CC=C(C)C)O |
| 753 | Siccanin | C22H30O3 |
342.50 g/mol |
CC1=CC(=C2C3C4C(CCC5C4(CCCC5(C)C)CO3)(OC2=C1)C)O |
| 754 | Skyrin | C30H18O10 |
538.50 g/mol |
CC1=CC2=C(C(=C1)O)C(=O)C3=C(C=C(C(=C3C2=O)C4=C5C(=C(C=C4O)O)C(=O)C6=C(C5=O)C=C(C=C6O)C)O)O |
| 755 | Solistatin | C18H20O3 |
284.30 g/mol |
CC1=C(C2=CC=CC=C2C=C1)CCC3CC(CC(=O)O3)O |
| 756 | Sorbicillin | C14H16O3 |
232.27 g/mol |
CC=CC=CC(=O)C1=C(C(=C(C(=C1)C)O)C)O |
| 757 | Speradine f | C21H22N2O7 |
414.40 g/mol |
CC(=O)C1(C(=O)N2C(C3CC4=C5C(=CC=C4)N(C(=O)C56C3C2(C1(O6)O)O)C)(C)C)O |
| 758 | Sphingofungin a | C21H41N3O6 |
431.60 g/mol |
CCCCCCC(CCCCCCC=CC(C(C(C(C(=O)O)N=C(N)N)O)O)O)O |
| 759 | Sphingofungin b | C20H39NO6 |
389.50 g/mol |
CCCCCCC(CCCCCCC=CC(C(C(C(C(=O)O)N)O)O)O)O |
| 760 | Sphingofungin c | C22H41NO7 |
431.60 g/mol |
CCCCCCC(CCCCCCC=CC(C(C(C(C(=O)O)N)O)O)OC(=O)C)O |