To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
701 | Questinol | C16H12O6 |
300.26 g/mol |
COC1=CC(=CC2=C1C(=O)C3=C(C2=O)C=C(C=C3O)CO)O |
702 | Questiomycin a | C12H8N2O2 |
212.20 g/mol |
C1=CC=C2C(=C1)N=C3C=C(C(=O)C=C3O2)N |
703 | Quinadoline a | C27H27N5O4 |
485.50 g/mol |
CC(=C1C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CC4(C5NC(C(=O)N5C6=CC=CC=C64)(C)C)O)C |
704 | Quinadoline b | C25H21N5O3 |
439.50 g/mol |
C1CC2C(=O)N3C(N2C1)C4(CC5C(=O)NC4C6=NC7=CC=CC=C7C(=O)N56)C8=CC=CC=C83 |
705 | Quinolactacin a | C16H18N2O2 |
270.33 g/mol |
CCC(C)C1C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1 |
706 | Quinolactacin a2 | C16H18N2O2 |
270.33 g/mol |
CCC(C)C1C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1 |
707 | Quinolactacin b | C15H16N2O2 |
256.30 g/mol |
CC(C)C1C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1 |
708 | Quinolactacin c | C16H18N2O3 |
286.33 g/mol |
CCC(C)C1(C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1)O |
709 | Radicinin | C12H12O5 |
236.22 g/mol |
CC=CC1=CC2=C(C(=O)C(C(O2)C)O)C(=O)O1 |
710 | Rasfonin | C25H38O6 |
434.60 g/mol |
CC=C(C)CC(C)CC(C)C1C(C=CC(=O)O1)OC(=O)C=CC(=CC(CCO)CO)C |