To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 781 | Synerazol | C22H23NO7 |
413.40 g/mol |
CCC=CC1C(O1)C2=C(C(=O)C3(O2)C(C(NC3=O)(C(=O)C4=CC=CC=C4)OC)O)C |
| 782 | T-2 toxin | C24H34O9 |
466.50 g/mol |
CC1=CC2C(CC1OC(=O)CC(C)C)(C3(C(C(C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C |
| 783 | T-2 triol | C20H30O7 |
382.40 g/mol |
CC1=CC2C(CC1OC(=O)CC(C)C)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| 784 | T2 tetraol | C15H22O6 |
298.33 g/mol |
CC1=CC2C(CC1O)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| 785 | Tajixanthone | C25H26O6 |
422.50 g/mol |
CC1=CC2=C(C3=C1OCC(C3O)C(=C)C)C(=O)C4=C(C=CC(=C4O2)CC5C(O5)(C)C)O |
| 786 | Taxol | C47H51NO14 |
853.90 g/mol |
CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C |
| 787 | Tenellin | C21H23NO5 |
369.40 g/mol |
CCC(C)C=C(C)C=CC(=O)C1=C(C(=CN(C1=O)O)C2=CC=C(C=C2)O)O |
| 788 | Tensidol b | C18H17NO6 |
343.30 g/mol |
CC(CC(=O)OC1=CN(C2=C1C(=CO2)O)CC3=CC=CC=C3)C(=O)O |
| 789 | Tentoxin | C22H30N4O4 |
414.50 g/mol |
CC1C(=O)NC(C(=O)N(C(=CC2=CC=CC=C2)C(=O)NCC(=O)N1C)C)CC(C)C |
| 790 | Tenuazonic acid | C10H15NO3 |
197.23 g/mol |
CCC(C)C1C(=C(C(=O)N1)C(=O)C)O |