To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 681 | Pr-imine | C17H21NO5 |
319.40 g/mol |
CC1C(C2C(O2)C3=CC4=NC(C5(C4(O5)CC13C)C)O)OC(=O)C |
| 682 | Preechinulin | C19H23N3O2 |
325.40 g/mol |
CC1C(=O)NC(C(=O)N1)CC2=C(NC3=CC=CC=C32)C(C)(C)C=C |
| 683 | Prehelminthosporol | C15H24O2 |
236.35 g/mol |
CC(C)C1CCC2(C3C1C(C2=C)C(OC3)O)C |
| 684 | Pseudodestruxin c | C36H55N5O7 |
669.90 g/mol |
CC1CCN2C1C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)NCCC(=O)OC(C2=O)CC(C)C)C(C)C)C)C(C)C)C)CC3=CC=CC=C3 |
| 685 | Pseurotin a | C22H25NO8 |
431.40 g/mol |
CCC=CC(C(C1=C(C(=O)C2(O1)C(C(NC2=O)(C(=O)C3=CC=CC=C3)OC)O)C)O)O |
| 686 | Pseurotin d | C18H28O4 |
308.40 g/mol |
CC1CCC=C(C(C=CC(C=CC(=O)OC1C)(C)O)OC)C |
| 687 | Pseurotin h | C17H17NO7 |
347.30 g/mol |
CC1=C(OC2(C1=O)C(C(NC2=O)(C(=O)C3=CC=CC=C3)OC)O)CO |
| 688 | Puberulin a | C23H28O6 |
400.50 g/mol |
CC1C(C2C(C1(C=C(C2=O)CC=C)OC)OC(=O)C)C3=CC(=C(C=C3)OC)OC |
| 689 | Puberuline | C27H29N3O3 |
443.50 g/mol |
CC(=O)N1C2C(CC3N2C(=O)C(NC3=O)CC4=CC=CC=C4)(C5=CC=CC=C51)C(C)(C)C=C |
| 690 | Purpactin a | C23H26O7 |
414.40 g/mol |
CC1=CC2=C(C(=C1)O)OC3=C(C(=C(C=C3)C(CC(C)C)OC(=O)C)OC)C(=O)OC2 |