To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
3121 | Fusarin L | C23H27NO6 |
413.50 g/mol |
CC=C(C=C(C)C=CC=CC=CC=C(C)C(=O)C12C(O1)C(NC2=O)(C)O)C(=O)OC |
3122 | 13-desoxypaxilline | C27H33NO3 |
419.60 g/mol |
CC12CCC3C(=CC(=O)C(O3)C(C)(C)O)C1CCC4C2(C5=C(C4)C6=CC=CC=C6N5)C |
3123 | 15-acetoxyscirpen-3,4-diol | C17H24O6 |
324.40 g/mol |
CC1=CC2C(CC1)(C3(C(C(C(C34CO4)O2)O)O)C)COC(=O)C |
3124 | 22-deacetylyanuthone a | C22H32O4 |
360.50 g/mol |
CC(=CCCC(=CCCC(=CCC12C(O1)C(C(=CC2=O)CO)O)C)C)C |
3125 | 2-monostearin | C21H42O4 |
358.60 g/mol |
CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO |
3126 | 3,11-diketofusidic acid | C31H44O6 |
512.70 g/mol |
CCC(=O)OC1CC2(C3CCC4C(C(=O)CCC4(C3C(=O)CC2C1=C(CCC=C(C)C)C(=O)O)C)C)C |
3127 | 4-acetyl-2-hydroxy-3-methyltetrahydrofuran | C7H12O3 |
144.17 g/mol |
CC1C(COC1O)C(=O)C |
3128 | 4'-methoxyviridicatin | C16H12NO3- |
266.27 g/mol |
COC1=CC=C(C=C1)C2=C(C(=O)NC3=CC=CC=C32)[O-] |
3129 | 5-(7,10-dihydro-8-methylfuro[2,3-g][1]benzoxepin-2-yl)-1,3-benzenediol | C19H16O4 |
308.30 g/mol |
CC1=CCC2=C(C=CC3=C2OC(=C3)C4=CC(=CC(=C4)O)O)OC1 |
3130 | 5'-epi-chaetoviridin a | C23H25ClO6 |
432.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(=C(C(=O)O3)C(=O)C(C)C(C)O)C2=CO1)C)Cl |