To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 3081 | chaetomugilin S | C23H29ClO5 |
420.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(C(C)CC)O)C)Cl |
| 3082 | cis-Bis(methylthio)silvatin | C20H28N2O3S2 |
408.60 g/mol |
CC(=CCOC1=CC=C(C=C1)CC2(C(=O)N(C(C(=O)N2C)SC)C)SC)C |
| 3083 | dihydroergotamin | C33H37N5O5 |
583.70 g/mol |
CC1(C(=O)N2C(C(=O)N3CCCC3C2(O1)O)CC4=CC=CC=C4)NC(=O)C5CC6C(CC7=CNC8=CC=CC6=C78)N(C5)C |
| 3084 | exo-1,2,7,7-Tetramethylbicyclo[2.2.1]heptan-2-ol | C11H20O |
168.28 g/mol |
CC1(C2CCC1(C(C2)(C)O)C)C |
| 3085 | malformin c | C23H39N5O5S2 |
529.70 g/mol |
CC(C)CC1C(=O)NC2CSSCC(C(=O)NC(C(=O)NC(C(=O)N1)CC(C)C)C(C)C)NC2=O |
| 3086 | seco-chaetomugilin A | C24H31ClO8 |
482.90 g/mol |
CC(C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(O3)(C(C)C(C)O)O)C(=O)OC)C)Cl)C(C)O |
| 3087 | seco-chaetomugilin D | C24H31ClO7 |
466.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(O3)(C(C)C(C)O)O)C(=O)OC)C)Cl |
| 3088 | siccanol | C25H38O4 |
402.60 g/mol |
CC1=CCCC(=CCC2(C(CC=C(C(CC1)O)C)C(=C(C2=O)O)C(C)CO)C)C |
| 3089 | trisorbicillinone a | C42H48O13 |
760.80 g/mol |
CC=CC=CC(=C1C2C(C(C(C1=O)(C(=O)C2(C)O)C)C=CC)C(=O)C3=C(C4(C5C(=C(C=CC=CC)O)C(=C(C(=O)C5(OC4(C(C3=O)(C)O)O)C)C)O)C)O)O |
| 3090 | trisorbicillinone d | C42H48O12 |
744.80 g/mol |
CC=CC=CC(=C1C2C(C(C(C1=O)(C(=O)C2(C)O)C)C=CC(=C3C4C5(C(=O)C(=C(C=CC=CC)O)C6C(C3=O)(C7(C4(OC5(C6(O7)C)O)C)O)C)C)O)C)O |