To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 3131 | 6-o-methylpapyracon c | C15H22O5 |
282.33 g/mol |
CC(C=C1CC(C23CC2C(OC3(C1=O)OC)(C)C)O)O |
| 3132 | aigialomycin g | C19H26O9 |
398.40 g/mol |
CC1CCCC(O1)(C(C(CC2C(C3=C(C(=CC(=C3)OC)O)C(=O)O2)O)O)O)O |
| 3133 | ajamxanthone | C25H24O4 |
388.50 g/mol |
CC1=C(C2=C(C=C1)OC3=C(C2=O)C(=C4CC5=CC(=C)C(C5(C4=C3)C)(C)C)CO)O |
| 3134 | alternariol 3,4',5-trihydroxy-6'-methyl-dibenzo[a]pyrone | C14H10O5 |
258.23 g/mol |
CC1=CC(=CC2=C1C3=C(C(=CC(=C3)O)O)C(=O)O2)O |
| 3135 | alternariol monomethyl ether | C15H12O5 |
272.25 g/mol |
CC1=CC(=CC2=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O |
| 3136 | alterporriol e | C32H30O16 |
670.60 g/mol |
CC1(C(C(C2=C(C1O)C(=O)C3=C(C2=O)C(=CC(=C3C4=C(C=C(C5=C4C(=O)C6=C(C5=O)C(C(C(C6O)(C)O)O)O)O)OC)OC)O)O)O)O |
| 3137 | andibenin b | C25H30O6 |
426.50 g/mol |
CC1(C2(CCC34CC5(C=C6C3(COC6=O)C(C5=O)(CC4C2(C)O)C)C)C=CC(=O)O1)C |
| 3138 | anguidol | C15H22O5 |
282.33 g/mol |
CC1=CC2C(CC1)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| 3139 | arestrictin b | C29H39N3O2 |
461.60 g/mol |
CC1C(=O)NC(C(=O)N1)CC2=C(NC3=C2C=CC(=C3CC=C(C)C)CC=C(C)C)C(C)(C)C=C |
| 3140 | arisugacin | C28H32O8 |
496.50 g/mol |
CC1(C=CC(=O)C2(C1(CCC3(C2(CC4=C(O3)C=C(OC4=O)C5=CC(=C(C=C5)OC)OC)O)C)O)C)C |