To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
2791 | 5-Chloro-6-methoxymellein | C11H11ClO4 |
242.65 g/mol |
CC1CC2=C(C(=CC(=C2Cl)OC)O)C(=O)O1 |
2792 | 6-Hydroxymellein | C10H10O4 |
194.18 g/mol |
CC1CC2=C(C(=CC(=C2)O)O)C(=O)O1 |
2793 | 6,8-Di-O-methylcitreoisocoumarin | C16H18O6 |
306.31 g/mol |
CC(=O)CC(CC1=CC2=CC(=CC(=C2C(=O)O1)OC)OC)O |
2794 | Asperentin | C16H20O5 |
292.33 g/mol |
CC1CCCC(O1)CC2CC3=C(C(=CC(=C3)O)O)C(=O)O2 |
2795 | dichlorodiaporthin | C13H12Cl2O5 |
319.13 g/mol |
COC1=CC(=C2C(=C1)C=C(OC2=O)CC(C(Cl)Cl)O)O |
2796 | Ramulosin | C10H14O3 |
182.22 g/mol |
CC1CC2CCCC(=C2C(=O)O1)O |
2797 | Dehydroaustin | C27H30O9 |
498.50 g/mol |
CC1C23C(=O)OC4(C(C5(O2)C(=C)C6(CCC5(C3(C4=C)C(=O)O1)C)C=CC(=O)OC6(C)C)OC(=O)C)C |
2798 | Janthitrem A | C37H47NO6 |
601.80 g/mol |
CC(=C)C1C(C2C3(O2)C(O1)CCC4(C3(CCC5C4(C6=C(C5)C7=CC8=C(C=C7N6)C9=CC(OC(C9C8O)(C)C)(C)C)C)O)C)O |
2799 | Janthitrem C | C37H47NO4 |
569.80 g/mol |
CC(=C)C1C(C=C2C(O1)CCC3(C2(CCC4C3(C5=C(C4)C6=C(N5)C=C7C(=C6)CC8C7=CC(OC8(C)C)(C)C)C)O)C)O |
2800 | Janthitrem D | C37H47NO5 |
585.80 g/mol |
CC(=C)C1C(C2C3(O2)C(O1)CCC4(C3(CCC5C4(C6=C(C5)C7=C(N6)C=C8C(=C7)CC9C8=CC(OC9(C)C)(C)C)C)O)C)O |