To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2781 | Communesin F | C28H32N4O |
440.60 g/mol |
CC(=CC1C2=C3C(=CC=C2)N(C4C35CCN1C6C5(CCN6C(=O)C)C7=CC=CC=C7N4)C)C |
| 2782 | Cryptoechinulin A | C24H27N3O2 |
389.50 g/mol |
CC(=CCC1=CC2=C(C=C1)C(=C(N2)C(C)(C)C=C)C=C3C(=O)NC(=C)C(=O)N3)C |
| 2783 | Brevianamide B | C21H23N3O3 |
365.40 g/mol |
CC1(C2CC34CCCN3C(=O)C2(CC15C(=O)C6=CC=CC=C6N5)NC4=O)C |
| 2784 | Brevianamide M | C18H15N3O3 |
321.30 g/mol |
C1=CC=C(C=C1)CC2C(=O)NC(C3=NC4=CC=CC=C4C(=O)N23)O |
| 2785 | Isoroquefortine C | C22H23N5O2 |
389.40 g/mol |
CC(C)(C=C)C12CC3C(=O)NC(=CC4=CN=CN4)C(=O)N3C1NC5=CC=CC=C25 |
| 2786 | Aurechinulin | C43H49N3O5 |
687.90 g/mol |
CC1CC2(C(C=C1)C=CC3=C(C=C(C(=C3C=O)O)CC=C(C)C)O)C(=O)NC(=CC4=C(NC5=C4C=CC(=C5)CC=C(C)C)C(C)(C)C=C)C(=O)N2 |
| 2787 | Slaframine | C10H18N2O2 |
198.26 g/mol |
CC(=O)OC1CCN2C1CCC(C2)N |
| 2788 | 3-Methyl-6-methoxy-8-hydroxy-3,4-dihydroisocoumarin | C11H12O4 |
208.21 g/mol |
CC1CC2=C(C(=CC(=C2)OC)O)C(=O)O1 |
| 2789 | 5-Carboxymellein | C11H10O5 |
222.19 g/mol |
CC1CC2=C(C=CC(=C2C(=O)O1)O)C(=O)O |
| 2790 | 5-Chloro-6-hydroxymellein | C10H9ClO4 |
228.63 g/mol |
CC1CC2=C(C(=CC(=C2Cl)O)O)C(=O)O1 |