To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2771 | Xyloketal D | C15H18O4 |
262.30 g/mol |
CC1COC2(C1CC3=C(O2)C=CC(=C3O)C(=O)C)C |
| 2772 | Xyloketal E | C26H36O6 |
444.60 g/mol |
CC1CC(OC1)(C)C2=C3C(=C4C(=C2O)CC5C(COC5(O4)C)C)CC6C(COC6(O3)C)C |
| 2773 | Xyloketal F | C41H52O10 |
704.80 g/mol |
CC1CC2CC3=C(C(=C4C(=C3OC2(O1)C)CC5C(COC5(O4)C)C)CC6=C7C(=C8C(=C6O)CC9C(COC9(O8)C)C)CC1C(COC1(O7)C)C)O |
| 2774 | Benesudon | C16H24O5 |
296.36 g/mol |
CCCCCCCC1C(C(C2=C(O1)OC(=C)C2=O)O)(C)O |
| 2775 | Niveulone | C27H38O5 |
442.60 g/mol |
CC1=CC(C2C3(CCC(C(C3CCC2(C14CC5=C(O4)C(=C(OC5=O)C)C)C)(C)C)O)C)O |
| 2776 | Pintulin | C14H12O5 |
260.24 g/mol |
C1C2=CC(=O)OC2=CC(O1)OCC3=CC(=CC=C3)O |
| 2777 | Phellodonic Acid | C23H32O6 |
404.50 g/mol |
CCCCCCCC(=O)OC1C2C(CC1(C)C(=O)O)CC34C2(C(=C)C(=O)C3O4)C |
| 2778 | 20-Hydroxyaflavinine | C28H39NO2 |
421.60 g/mol |
CC1CCC(C23C1(C(CC(C2C(=C(CC3)C(C)C)C4=CNC5=CC=CC=C54)C)O)C)O |
| 2779 | Epoxyfumitremorgin C | C22H23N3O4 |
393.40 g/mol |
CC(=CC1C2=C(C3C4(N1C(=O)C5CCCN5C4=O)O3)C6=C(N2)C=C(C=C6)OC)C |
| 2780 | Mellamide | C23H31N3O2 |
381.50 g/mol |
CC(C)C(C(=O)NC=CC1=CNC2=C1C=CC=C2C(C)(C)C=C)N(C)C(=O)C |