To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
2691 | Fusicoccin | C36H56O12 |
680.80 g/mol |
CC1C2CCC(C2=CC3(C(CC(=C3C(C1O)OC4C(C(C(C(O4)COC(C)(C)C=C)O)OC(=O)C)O)C(C)COC(=O)C)O)C)COC |
2692 | Acetylaranotin | C22H20N2O8S2 |
504.50 g/mol |
CC(=O)OC1C=COC=C2C1N3C(=O)C45CC6=COC=CC(C6N4C(=O)C3(C2)SS5)OC(=O)C |
2693 | Aranotin | C20H18N2O7S2 |
462.50 g/mol |
CC(=O)OC1C=COC=C2C1N3C(=O)C45CC6=COC=CC(C6N4C(=O)C3(C2)SS5)O |
2694 | FR-49175 | C15H20N2O4S2 |
356.50 g/mol |
CN1C(=O)C2(CC3=CC=CC(C3N2C(=O)C1(CO)SC)O)SC |
2695 | Dehydroxybisdethiobis(methylthio) gliotoxin | C15H20N2O3S2 |
340.50 g/mol |
CC1(C(=O)N2C3C(C=CC=C3CC2(C(=O)N1C)SC)O)SC |
2696 | Chaetomin | C31H30N6O6S4 |
710.90 g/mol |
CN1C(=O)C2(N(C(=O)C1(SS2)CC3=CN(C4=CC=CC=C43)C56CC78C(=O)N(C(C(=O)N7C5NC9=CC=CC=C69)(SS8)CO)C)C)CO |
2697 | Chetracin A | C30H28N6O8S8 |
857.10 g/mol |
CN1C(=O)C23C(C4(C(N2C(=O)C1(SSSS3)CO)NC5=CC=CC=C54)C67C(C89C(=O)N(C(C(=O)N8C6NC1=CC=CC=C71)(SSSS9)CO)C)O)O |
2698 | Emethallicin B | C34H28N2O8S4 |
720.90 g/mol |
C1C2=CC=CC(C2N3C14C(=O)N5C6C(C=COC=C6CC5(C3=O)SSSS4)OC(=O)C(C7=CC=CC=C7)O)OC(=O)CC8=CC=CC=C8 |
2699 | Emethallicin C | C34H28N2O10S4 |
752.90 g/mol |
C1C2=COC=CC(C2N3C14C(=O)N5C6C(C=COC=C6CC5(C3=O)SSSS4)OC(=O)C(C7=CC=CC=C7)O)OC(=O)C(C8=CC=CC=C8)O |
2700 | Epicorazine B | C18H16N2O6S2 |
420.50 g/mol |
C1C2C(C(C=CC2=O)O)N3C14C(=O)N5C6C(CC5(C3=O)SS4)C(=O)C=CC6O |