To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2681 | Ustin | C19H15Cl3O5 |
429.70 g/mol |
CC=C(C)C1=C(C(=C(C2=C1OC3=C(C(=C(C(=C3C(=O)O2)C)Cl)O)Cl)C)O)Cl |
| 2682 | Neoplaether | C18H19NO7 |
361.30 g/mol |
CC1=CC(=C(C(=C1)OC2=C(C=C(C=C2OC)O)C(=O)OC)C(=O)N)OC |
| 2683 | Xanthoascin | C23H20N2O2 |
356.40 g/mol |
CC1(CCC2=C(O1)C=CC(=C2)C=C(C(=CC3=CC=C(C=C3)O)[N+]#[C-])[N+]#[C-])C |
| 2684 | Gypsetin | C32H36N4O4 |
540.70 g/mol |
CC(C)(C=C)C12C(CC3N1C(=O)C4CC5(C6=CC=CC=C6NC5(N4C3=O)C(C)(C)C=C)O)(C7=CC=CC=C7N2)O |
| 2685 | Deoxyisoaustamide | C21H21N3O2 |
347.40 g/mol |
CC1(C=CN2C(CC3=C1NC4=CC=CC=C34)C(=O)N5CCC=C5C2=O)C |
| 2686 | Fructigenine A | C27H29N3O3 |
443.50 g/mol |
CC(=O)N1C2C(CC3N2C(=O)C(NC3=O)CC4=CC=CC=C4)(C5=CC=CC=C51)C(C)(C)C=C |
| 2687 | Fructigenine B | C24H31N3O3 |
409.50 g/mol |
CC(C)CC1C(=O)N2C(CC3(C2N(C4=CC=CC=C43)C(=O)C)C(C)(C)C=C)C(=O)N1 |
| 2688 | Aspergillazine A | C20H20N2O8S |
448.40 g/mol |
COC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C34CC5(C(S3)C=CC(C5ON4)O)O)OC |
| 2689 | Aspergillazine C | C20H22N2O8S |
450.50 g/mol |
COC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3(CC4(C(S3)C=CC(C4O)O)O)N)OC |
| 2690 | Aspergillazine D | C20H22N2O9 |
434.40 g/mol |
COC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3(CC4(C(O3)C=CC(C4O)O)O)N)OC |