To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2661 | Echinocandin C | C52H81N7O15 |
1044.20 g/mol |
CCCCCC=CCC=CCCCCCCCC(=O)NC1CC(C(NC(=O)C2C(C(CN2C(=O)C(NC(=O)C(NC(=O)C3CC(CN3C(=O)C(NC1=O)C(C)O)O)C(CC4=CC=C(C=C4)O)O)C(C)O)C)O)O)O |
| 2662 | Echinocandin D | C52H81N7O13 |
1012.20 g/mol |
CCCCCC=CCC=CCCCCCCCC(=O)NC1CCCNC(=O)C2C(C(CN2C(=O)C(NC(=O)C(NC(=O)C3CC(CN3C(=O)C(NC1=O)C(C)O)O)C(CC4=CC=C(C=C4)O)O)C(C)O)C)O |
| 2663 | Islanditoxin | C24H31Cl2N5O7 |
572.40 g/mol |
CCC1C(=O)NC(C(=O)NC(C(=O)N2CC(C(C2C(=O)NC(CC(=O)N1)C3=CC=CC=C3)Cl)Cl)CO)CO |
| 2664 | JM47 | C21H34N4O6 |
438.50 g/mol |
CC1C(=O)NC(C(=O)N2CCCC2C(=O)NC(C(=O)N1)C)CCCCCC(=O)C(C)O |
| 2665 | Argifin | C29H41N9O10 |
675.70 g/mol |
CC1C(=O)NC(C(=O)N(C(C(=O)NC(CC(=O)NC(CC(=O)N1)C(=O)O)C(=O)O)CC2=CC=CC=C2)C)CCCN=C(N)NC(=O)NC |
| 2666 | 18-Deoxy-19,20-epoxycytochalasin R | C30H37NO7 |
523.60 g/mol |
CC1CC2C(O2)C3C4C(O4)(C(C5C3(C(C6C(O6)C(C1=O)C)OC(=O)C)C(=O)NC5CC7=CC=CC=C7)C)C |
| 2667 | 19,20-Epoxycytochalasin C | C30H37NO7 |
523.60 g/mol |
CC1CC=CC2C(C(=C(C3C2(C(C4C(O4)C(C1=O)(C)O)OC(=O)C)C(=O)NC3CC5=CC=CC=C5)C)C)O |
| 2668 | 19,20-Epoxycytochalasin R | C30H37NO8 |
539.60 g/mol |
CC1CC2C(O2)C3C4C(O4)(C(C5C3(C(C6C(O6)C(C1=O)(C)O)OC(=O)C)C(=O)NC5CC7=CC=CC=C7)C)C |
| 2669 | Chaetoglobosin K | C34H40N2O5 |
556.70 g/mol |
CCC1C2C(NC(=O)C23C(C=CCC(C=C(C(C(=O)C=CC3=O)O)C)C)C4C1(O4)C)C(C)C5=CNC6=CC=CC=C65 |
| 2670 | Chaetoglobosin L | C23H26O7 |
414.40 g/mol |
CC1CC(=C(C=CC2=CC=C(C(=C3C(=C(C(O3)(C(C1=O)C(=O)O)C)O)O)O2)C)C)C |