To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2411 | Terreusinol | C18H22N2O5 |
346.40 g/mol |
CC(C)C(C1=CC2=C(N1)C(=O)C3=C(C2=O)NC(=C3)C(C(C)(C)O)O)O |
| 2412 | Terreusinone | C18H22N2O4 |
330.40 g/mol |
CC(C)C(C1=CC2=C(N1)C(=O)C3=C(C2=O)NC(=C3)C(C(C)C)O)O |
| 2413 | Tetrathioaspirochlorine | C12H9ClN2O5S4 |
424.90 g/mol |
CON1C(=O)C2NC(=O)C13C(C4=CC(=C(C=C4O3)O)Cl)SSSS2 |
| 2414 | Thailandolide b | C27H34O8 |
486.60 g/mol |
CC1C(C2=C(C(=CC3=C2CC4C5(CCC(=O)C(C5CC(C4(O3)C)O)(C)C)C)O)C(=O)O1)OC(=O)C |
| 2415 | Thiamine | C12H17N4OS+ |
265.36 g/mol |
CC1=C(SC=[N+]1CC2=CN=C(N=C2N)C)CCO |
| 2416 | Thielavin a | C29H30O10 |
538.50 g/mol |
CC1=CC(=C(C(=C1C(=O)OC2=C(C(=C(C(=C2C)C)C(=O)OC3=C(C(=C(C(=C3C)C)C(=O)O)O)C)O)C)O)C)O |
| 2417 | Thielavin f | C30H32O10 |
552.60 g/mol |
CC1=CC(=C(C(=C1C(=O)OC2=C(C(=C(C(=C2C)C)C(=O)OC3=CC(=C(C(=C3C)C)C(=O)O)OC)OC)C)O)C)O |
| 2418 | Thielavin g | C30H32O10 |
552.60 g/mol |
CC1=CC(=C(C(=C1C(=O)OC2=CC(=C(C(=C2C)C)C(=O)OC3=C(C(=C(C(=C3C)C)C(=O)O)OC)C)OC)O)C)O |
| 2419 | Thielavin h | C28H28O10 |
524.50 g/mol |
CC1=CC(=CC(=C1C(=O)OC2=C(C(=C(C(=C2C)C)C(=O)OC3=C(C(=C(C(=C3C)C)C(=O)O)O)C)O)C)O)O |
| 2420 | Thielavin i | C28H30O8 |
494.50 g/mol |
CC1=CC(=C(C(=C1C)OC(=O)C2=C(C(=C(C(=C2C)C)OC(=O)C3=C(C(=C(C=C3C)O)C)O)C)O)C)O |