To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2381 | Tenellone b | C25H28O6 |
424.50 g/mol |
CC1=CC(=C2C(=C1)OCC(O2)C(C)(C)O)C(=O)C3=C(C=CC(=C3C=O)O)CC=C(C)C |
| 2382 | Tensyuic acid a | C11H16O6 |
244.24 g/mol |
COC(=O)CCCC(C(=C)C(=O)O)C(=O)OC |
| 2383 | Tensyuic acid f | C11H16O6 |
244.24 g/mol |
CCOC(=O)CCCC(C(=C)C(=O)O)C(=O)O |
| 2384 | Terezine a | C15H18N2O3 |
274.31 g/mol |
CC(C)C1=NC(=C(NC1=O)C(C2=CC=CC=C2)O)OC |
| 2385 | Terezine b | C16H22N2O5 |
322.36 g/mol |
CC(C)C1(C(=O)NC(C(=N1)OC)(C(C2=CC=CC=C2)O)O)OC |
| 2386 | Terezine c | C16H22N2O5 |
322.36 g/mol |
CC(C)C1(C(=O)NC(C(=N1)OC)(C(C2=CC=CC=C2)O)O)OC |
| 2387 | Terezine d | C19H23N3O2 |
325.40 g/mol |
CC1C(=O)NC(C(=O)N1)CC2=CNC3=C(C=CC=C23)CC=C(C)C |
| 2388 | Terpendole i | C27H35NO5 |
453.60 g/mol |
CC12CCC3C4(C1(CCC5C2(C6=C(C5)C7=CC=CC=C7N6)C)O)C(O4)C(C(O3)C(C)(C)O)O |
| 2389 | Terpeptin | C28H40N4O3 |
480.60 g/mol |
CC(C)C(C(=O)N(C)C(C(C)C)C(=O)NC=CC1=C(NC2=CC=CC=C21)CC=C(C)C)NC(=O)C |
| 2390 | Terprenin | C25H26O6 |
422.50 g/mol |
CC(=CCOC1=C(C=C(C=C1)C2=C(C=C(C(=C2O)OC)C3=CC=C(C=C3)O)OC)O)C |