To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2451 | Trichodermadiene | C23H30O5 |
386.50 g/mol |
CC1C(O1)C=CC=CC(=O)OC2CC3C4(C2(C5(CCC(=CC5O3)C)C)C)CO4 |
| 2452 | Trichodermadienediol a | C23H32O6 |
404.50 g/mol |
CC1=CC2C(CC1)(C3(C(CC(C34CO4)O2)OC(=O)C=CC=CC(C(C)O)O)C)C |
| 2453 | Trichodermadienediol b | C23H32O6 |
404.50 g/mol |
CC1=CC2C(CC1)(C3(C(CC(C34CO4)O2)OC(=O)C=CC=CC(C(C)O)O)C)C |
| 2454 | Trichodermamide a | C20H20N2O9 |
432.40 g/mol |
COC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3=NOC4C(C=CC(C4(C3)O)O)O)OC |
| 2455 | Trichodermamide b | C20H19ClN2O8 |
450.80 g/mol |
COC1=C(C2=C(C=C1)C=C(C(=O)O2)NC(=O)C3=NOC4C(C=CC(C4(C3)O)Cl)O)OC |
| 2456 | Trichodiol | C15H24O3 |
252.35 g/mol |
CC1(CCC(C=C1)(C)O)C2(CCC(C23CO3)O)C |
| 2457 | Trichodiol a | C15H24O3 |
252.35 g/mol |
CC1(CCC(C=C1)(C)O)C2(CCC3C2(O3)CO)C |
| 2458 | Trichorzin pau 4 | C83H138N20O23 |
1784.10 g/mol |
CC(C)CC(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC2=CC=C(C=C2)O)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(C(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(C)(C)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(C)(C)NC(=O)C |
| 2459 | Trichoverritone | C35H46O11 |
642.70 g/mol |
CC1=CC2C(CC1)(C3(C(CC(C34CO4)O2)OC(=O)C=CC=CC(C(C)O)OCCC5=CC(=O)OC5)C)COC(=O)C=C(C)CCO |
| 2460 | Tricitrinol a | C37H44O9 |
632.70 g/mol |
CC1C(OC(C2=C(C=C(C(=C12)C)O)O)C3=C(C(=C4C(C(OC5C4=C3OC6=C7C(OC(C(C7=C(C(=C56)O)C)C)C)OC)C)C)C)O)C |