To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 231 | Chaetoglobosin d | C32H36N2O5 |
528.60 g/mol |
CC1CC=CC2C(C(=C)C(C3C2(C(=O)C=CC(=O)C(C(=C1)C)O)C(=O)NC3CC4=CNC5=CC=CC=C54)C)O |
| 232 | Chaetominine | C22H18N4O4 |
402.40 g/mol |
CC1C(=O)N2C3N1C(=O)C(CC3(C4=CC=CC=C42)O)N5C=NC6=CC=CC=C6C5=O |
| 233 | Chaetomugilin a | C23H27ClO7 |
450.90 g/mol |
CC1C(OC(=O)C2C1(OC3(C2C4=COC(=CC4=C(C3=O)Cl)C=CC(C)C(C)O)C)O)C |
| 234 | Chaetomugilin b | C24H29ClO7 |
464.90 g/mol |
CC1C(OC(=O)C2C1(OC3(C2C4=COC(=CC4=C(C3=O)Cl)C=CC(C)C(C)O)C)OC)C |
| 235 | Chaetomugilin c | C23H25ClO6 |
432.90 g/mol |
CC1C(OC(=O)C2=C1OC3(C2C4=COC(=CC4=C(C3=O)Cl)C=CC(C)C(C)O)C)C |
| 236 | Chaetomugilin d | C23H27ClO6 |
434.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C4C(=O)OC(C(C4(O3)O)C)C)C)Cl |
| 237 | Chaetomugilin e | C24H29ClO6 |
448.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C4C(=O)OC(C(C4(O3)OC)C)C)C)Cl |
| 238 | Chaetoviridin a | C23H25ClO6 |
432.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(=C(C(=O)O3)C(=O)C(C)C(C)O)C2=CO1)C)Cl |
| 239 | Chaetoviridin c | C23H27ClO6 |
434.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)C(C)C(C)O)C)Cl |
| 240 | Chanoclavine i | C16H20N2O |
256.34 g/mol |
CC(=CC1C(CC2=CNC3=CC=CC1=C23)NC)CO |