To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 191 | Bostrycin | C16H16O8 |
336.29 g/mol |
CC1(CC2=C(C(C1O)O)C(=C3C(=O)C=C(C(=O)C3=C2O)OC)O)O |
| 192 | Bostrycoidin | C15H11NO5 |
285.25 g/mol |
CC1=CC2=C(C=N1)C(=O)C3=C(C2=O)C(=C(C=C3O)OC)O |
| 193 | Botryodiplodin | C7H12O3 |
144.17 g/mol |
CC1C(COC1O)C(=O)C |
| 194 | Brefeldin a | C16H24O4 |
280.36 g/mol |
CC1CCCC=CC2CC(CC2C(C=CC(=O)O1)O)O |
| 195 | Brevianamide a | C21H23N3O3 |
365.40 g/mol |
CC1(C2CC34CCCN3C(=O)C2(CC15C(=O)C6=CC=CC=C6N5)NC4=O)C |
| 196 | Brevicompanine b | C22H29N3O2 |
367.50 g/mol |
CC(C)CC1C(=O)N2C(CC3(C2NC4=CC=CC=C43)C(C)(C)C=C)C(=O)N1 |
| 197 | Brevigellin | C31H41N5O7 |
595.70 g/mol |
CC1CC(=O)OC(C(C(=O)NC(C(=O)N2CCCC2C(=O)N3CCC(=C3)CCCC(=O)N1)C)NC(=O)C4=CC=CC=C4)C |
| 198 | Brevione a | C27H34O4 |
422.60 g/mol |
CC1=CCC2C(C13CC4=C(O3)C(=C(OC4=O)C)C)(CCC5C2(C=CC(=O)C5(C)C)C)C |
| 199 | Brevione b | C27H36O4 |
424.60 g/mol |
CC1=CCC2C3(CCC(=O)C(C3CCC2(C14CC5=C(O4)C(=C(OC5=O)C)C)C)(C)C)C |
| 200 | Brevione c | C27H32O4 |
420.50 g/mol |
CC1=CCC2C(C13CC4=C(O3)C(=C(OC4=O)C)C)(CCC5C2(C=CC(=O)C=C5C)C)C |