To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 261 | Cladofulvin | C30H18O10 |
538.50 g/mol |
CC1=CC2=C(C(=C1C3=C4C(=C(C=C3C)O)C(=O)C5=C(C4=O)C=CC(=C5O)O)O)C(=O)C6=C(C2=O)C=CC(=C6O)O |
| 262 | Cladosporin | C16H20O5 |
292.33 g/mol |
CC1CCCC(O1)CC2CC3=C(C(=CC(=C3)O)O)C(=O)O2 |
| 263 | Clerocidin | C40H56O10 |
696.90 g/mol |
CC1CCC2(C(C1(C)CC3C4(CO4)C5(C(O3)OC6(C(O5)OC(C67CO7)CC8(C(CCC9(C8CCC=C9C=O)C)C)C)O)O)CCC=C2C=O)C |
| 264 | Clonostachydiol | C14H20O6 |
284.30 g/mol |
CC1CCC(C=CC(=O)OC(C(C=CC(=O)O1)O)C)O |
| 265 | Cochliodinol | C32H30N2O4 |
506.60 g/mol |
CC(=CCC1=CC2=C(C=C1)NC=C2C3=C(C(=O)C(=C(C3=O)O)C4=CNC5=C4C=C(C=C5)CC=C(C)C)O)C |
| 266 | Communesin a | C28H32N4O2 |
456.60 g/mol |
CC(=O)N1CCC23C1N4CCC25C(NC6=CC=CC=C36)N(C7=CC=CC(=C57)C4C8C(O8)(C)C)C |
| 267 | Communesin b | C32H36N4O2 |
508.70 g/mol |
CC=CC=CC(=O)N1CCC23C1N4CCC25C(NC6=CC=CC=C36)N(C7=CC=CC(=C57)C4C8C(O8)(C)C)C |
| 268 | Compactin | C23H34O5 |
390.50 g/mol |
CCC(C)C(=O)OC1CCC=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O |
| 269 | Cordycepin | C10H13N5O3 |
251.24 g/mol |
C1C(OC(C1O)N2C=NC3=C(N=CN=C32)N)CO |
| 270 | Costaclavine | C16H20N2 |
240.34 g/mol |
CC1CC2C(CC3=CNC4=CC=CC2=C34)N(C1)C |