To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2191 | Putaminoxin d | C14H24O3 |
240.34 g/mol |
CCCCCC1CC=CC(CCCC(=O)O1)O |
| 2192 | Putaminoxin e | C12H22O3 |
214.30 g/mol |
CCCC1CCCC(CCCC(=O)O1)O |
| 2193 | Pyranonigrin a | C10H9NO5 |
223.18 g/mol |
CC=CC1=C(C(=O)C2=C(O1)C(NC2=O)O)O |
| 2194 | Pyranonigrin b | C11H11NO6 |
253.21 g/mol |
CC=CC1=C(C(=O)C2=C(O1)C(=C(N2O)O)OC)O |
| 2195 | Pyranonigrin c | C11H11NO6 |
253.21 g/mol |
CC=CC1=C(C(=O)C2=C(O1)C(=C(N2O)OC)O)O |
| 2196 | Pyranonigrin d | C11H9NO5 |
235.19 g/mol |
CC=CC1=C(C(=O)C2=C(O1)C3=C(N2)OCO3)O |
| 2197 | Pyrenocine b | C11H14O5 |
226.23 g/mol |
CC1=C(C(=CC(=O)O1)OC)C(=O)CC(C)O |
| 2198 | Pyrenocine d | C11H12O4 |
208.21 g/mol |
CC=C(C=O)C1=C(OC(=O)C=C1OC)C |
| 2199 | Pyrenocine e | C12H16O5 |
240.25 g/mol |
CC1=C(C(=CC(=O)O1)OC)C(=O)CC(C)OC |
| 2200 | Pyridomacrolidin | C31H35NO10 |
581.60 g/mol |
CCC(CO)C=C(C)C=CC(=O)C1=C(C(=C2C3C(C(CC(=O)OC(CCC3=O)C)O)ON2C1=O)C4=CC=C(C=C4)O)O |