To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2211 | Quinocitrinine b | C16H19N2O2+ |
271.33 g/mol |
CCC(C)C1C2=C(C=C3C=CC(=CC3=[N+]2C)O)C(=O)N1 |
| 2212 | Quinolactacide | C14H8N2O2 |
236.22 g/mol |
C1=CC=C2C(=C1)C(=O)C3=C(N2)C4=CC=CN4C3=O |
| 2213 | Quinolactacin a1 | C16H18N2O2 |
270.33 g/mol |
CCC(C)C1C2=C(C(=O)C3=CC=CC=C3N2C)C(=O)N1 |
| 2214 | Radarin a | C28H39NO2 |
421.60 g/mol |
CC1CCC2(C3CCC(=O)C(C3(CCC2C1(C)CC4=CNC5=C4C=CC(=C5)O)C)C)C |
| 2215 | Radarin b | C28H41NO2 |
423.60 g/mol |
CC1CCC2(C3CCC(C(C3(CCC2C1(C)CC4=CNC5=C4C=CC(=C5)O)C)C)O)C |
| 2216 | Radicicol | C18H17ClO6 |
364.80 g/mol |
CC1CC2C(O2)C=CC=CC(=O)CC3=C(C(=CC(=C3Cl)O)O)C(=O)O1 |
| 2217 | Radicinol | C12H14O5 |
238.24 g/mol |
CC=CC1=CC2=C(C(C(C(O2)C)O)O)C(=O)O1 |
| 2218 | Ravenic acid | C15H17NO3 |
259.30 g/mol |
CC=CC=CC=C(C)C=CC(=C1C(=O)CNC1=O)O |
| 2219 | Resveratrol | C14H12O3 |
228.24 g/mol |
C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O |
| 2220 | Rhizonin a | C42H65N7O9 |
812.00 g/mol |
CCC(C)C1C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N1)CC2=COC=C2)C)C)C)CC(C)C)CC3=COC=C3)C)C(C)C)C(C)C |