To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2151 | Phomolide b | C12H18O4 |
226.27 g/mol |
CCCC1CC2C(O2)C=CC(CC(=O)O1)O |
| 2152 | Phomonitroester | C11H13NO5 |
239.22 g/mol |
C1=CC(=CC=C1CCOC(=O)CC[N+](=O)[O-])O |
| 2153 | Phomopsichalasin | C32H41NO4 |
503.70 g/mol |
CC1CCC2C3C(C(=CC2(C1)C)C)C4(C=C(C(C5C4(C3=O)C(=O)NC5(CC6=CC=C(C=C6)O)O)C)C)C |
| 2154 | Phomoxanthone a | C38H38O16 |
750.70 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3OC2(C1OC(=O)C)COC(=O)C)C4=C5C(=C(C=C4)O)C(=C6C(=O)CC(C(C6(O5)COC(=O)C)OC(=O)C)C)O)O)O |
| 2155 | Phomoxanthone b | C38H38O16 |
750.70 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)CC(C(C6(O5)COC(=O)C)OC(=O)C)C)O)OC2(C1OC(=O)C)COC(=O)C)O |
| 2156 | Picolinic acid | C6H5NO2 |
123.11 g/mol |
C1=CC=NC(=C1)C(=O)O |
| 2157 | Pimara-8,15-diene | C20H32 |
272.50 g/mol |
CC1(CCCC2(C1CCC3=C2CCC(C3)(C)C=C)C)C |
| 2158 | Pinophilin a | C21H22O7 |
386.40 g/mol |
CC=CC1=CC2=CC(=O)C(C(C2CO1)O)(C)OC(=O)C3=C(C=C(C=C3C)O)O |
| 2159 | Pinophilin b | C21H22O8 |
402.40 g/mol |
CC1=CC(=CC(=C1C(=O)OC2C3COC(=CC3=CC(=O)C2(C)O)C=CCO)O)O |
| 2160 | Pistillarin | C21H27N3O6 |
417.50 g/mol |
C1=CC(=C(C=C1C(=O)NCCCCNCCCNC(=O)C2=CC(=C(C=C2)O)O)O)O |