To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 181 | Berkedrimane b | C22H33NO6 |
407.50 g/mol |
CC(C)C(C(=O)OC1CCC(C2C1(C3(COC(=O)C3=CC2)O)C)(C)C)NC(=O)C |
| 182 | Berkeleyacetal b | C26H30O9 |
486.50 g/mol |
CC1C(=O)C2(C3C(O1)OC(=O)C3(CC4C2(CC=C5C(=CC(=O)OC5(C)C)C46CO6)C)C)C(=O)OC |
| 183 | Beta-aflatrem | C32H39NO4 |
501.70 g/mol |
CC1(C2C(=O)C=C3C4(CCC5CC6=C(C5(C4(CCC3(O2)O1)C)C)NC7=C6C=C(C=C7)C(C)(C)C=C)O)C |
| 184 | Beta-amanitin | C39H53N9O15S |
920.00 g/mol |
CCC(C)C1C(=O)NCC(=O)NC2CS(=O)C3=C(CC(C(=O)NCC(=O)N1)NC(=O)C(NC(=O)C4CC(CN4C(=O)C(NC2=O)CC(=O)O)O)C(C)C(CO)O)C5=C(N3)C=C(C=C5)O |
| 185 | Beta-paxitriol | C27H35NO4 |
437.60 g/mol |
CC12CCC3C(=CC(C(O3)C(C)(C)O)O)C1(CCC4C2(C5=C(C4)C6=CC=CC=C6N5)C)O |
| 186 | Beta-zearalanol | C18H26O5 |
322.40 g/mol |
CC1CCCC(CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| 187 | Beta-zearalenol | C18H24O5 |
320.40 g/mol |
CC1CCCC(CCCC=CC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| 188 | Bikaverin | C20H14O8 |
382.30 g/mol |
CC1=CC(=CC2=C1C(=O)C3=C(O2)C(=O)C4=C(C3=O)C(=CC(=C4O)OC)O)OC |
| 189 | Bis(2-ethylhexyl)phthalate | C24H38O4 |
390.60 g/mol |
CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC |
| 190 | Bis(methylthio)gliotoxin | C15H20N2O4S2 |
356.50 g/mol |
CN1C(=O)C2(CC3=CC=CC(C3N2C(=O)C1(CO)SC)O)SC |