To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1631 | Epicoccin g | C20H26N2O6S2 |
454.60 g/mol |
CSC12CC3C(N1C(=O)C4(CC5C(N4C2=O)C(CCC5=O)O)SC)C(CCC3=O)O |
| 1632 | Epicoccin h | C20H26N2O8S2 |
486.60 g/mol |
CSC12CC3C(N1C(=O)C4(CC5C(N4C2=O)C(C(CC5=O)O)O)SC)C(C(CC3=O)O)O |
| 1633 | Epicocconone | C23H22O7 |
410.40 g/mol |
CC=CC=CC=CC(=O)C=C(C1=C2C=C3CC(OC=C3C(=O)C2(OC1=O)C)CO)O |
| 1634 | Epierythrostominol | C17H18O8 |
350.30 g/mol |
CC(CC1CC(C2=C(C3=C(C(=C2O1)O)C(=O)C(=CC3=O)OC)O)O)O |
| 1635 | Epoformin | C7H8O3 |
140.14 g/mol |
CC1=CC(C2C(C1=O)O2)O |
| 1636 | Epoxycytochalasin h | C30H39NO5 |
493.60 g/mol |
CC1CC=CC2C3C(O3)(C(C4C2(C(C=CC(C1)(C)O)OC(=O)C)C(=O)NC4CC5=CC=CC=C5)C)C |
| 1637 | Epoxycytochalasin j | C28H37NO4 |
451.60 g/mol |
CC1CC=CC2C3C(O3)(C(C4C2(C(C=CC(C1)(C)O)O)C(=O)NC4CC5=CC=CC=C5)C)C |
| 1638 | Epoxyexserohilone | C20H22N2O6S2 |
450.50 g/mol |
CSC12CC3=CC(C4C(C3N1C(=O)C5(CC6=CC(C7C(C6N5C2=O)O7)O)SC)O4)O |
| 1639 | Epurpurin a | C28H28N2O2 |
424.50 g/mol |
CC(=CCC1=C(C=CC(=C1)C=C(C#N)C(=CC2=CC(=C(C=C2)O)CC=C(C)C)C#N)O)C |
| 1640 | Epurpurin b | C23H20N2O2 |
356.40 g/mol |
CC(=CCC1=C(C=CC(=C1)C=C(C#N)C(=CC2=CC=C(C=C2)O)C#N)O)C |