To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1641 | Epurpurin c | C18H12N2O2 |
288.30 g/mol |
C1=CC(=CC=C1C=C(C#N)C(=CC2=CC=C(C=C2)O)C#N)O |
| 1642 | Erabulenol a | C20H20O6 |
356.40 g/mol |
CC1C(C2=C(O1)C3=C4C(=C(C=C3C)O)C(=O)C(=C(C4=C2O)O)OC)(C)C |
| 1643 | Erabulenol b | C30H30O10 |
550.60 g/mol |
CC1C(C2(C(=C3C(=C(C(=O)C4=C3C(=C(C(=C4O)OC)O)C2=O)CC5=C(C(=CC(=C5O)C(=O)C)C)O)C)O1)O)(C)C |
| 1644 | Eremofortin d | C17H24O6 |
324.40 g/mol |
CC1C(C2C(O2)C3C1(CC45C(O4)(COC5(C3)O)C)C)OC(=O)C |
| 1645 | Eremofortin e | C17H21NO6 |
335.40 g/mol |
CC1C(C2C(O2)C3=CC(=O)C4(CC13C)C(O4)(C)C(=O)N)OC(=O)C |
| 1646 | Erginine | C16H17N3O |
267.33 g/mol |
CN1CC(C=C2C1CC3=CNC4=CC=CC2=C34)C(=O)N |
| 1647 | Ergobutine | C29H35N5O5 |
533.60 g/mol |
CCC1C(=O)N2CCCC2C3(N1C(=O)C(O3)(CC)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
| 1648 | Ergobutyrine | C30H37N5O5 |
547.60 g/mol |
CCC1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
| 1649 | Ergocorninine | C31H39N5O5 |
561.70 g/mol |
CC(C)C1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |
| 1650 | Ergonine | C30H37N5O5 |
547.60 g/mol |
CCC1(C(=O)N2C(C(=O)N3CCCC3C2(O1)O)C(C)C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C |