To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1591 | Dihydromevinolin | C24H38O5 |
406.60 g/mol |
CCC(C)C(=O)OC1CC(CC2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O)C |
| 1592 | Dihydroprehelminthosporol | C15H26O2 |
238.37 g/mol |
CC(C)C1CCC2(C(C1C(C2=C)CO)CO)C |
| 1593 | Dihydrotubingensin a | C28H37NO |
403.60 g/mol |
CC1CCC(C2(C1(CCC3=C2CC4=C(C3)NC5=CC=CC=C45)C)CCC=C(C)C)O |
| 1594 | Dihydroxybergamotene | C15H24O2 |
236.35 g/mol |
CC(=CCC(C1(C2CC1(CCC2=C)O)C)O)C |
| 1595 | Dihydroxyisoechinulin a | C24H31N3O4 |
425.50 g/mol |
CC1C(=O)NC(=CC2=C(NC3=C2C=C(C=C3)CC(C(C)(C)O)O)C(C)(C)C=C)C(=O)N1 |
| 1596 | Diphenylalazine a | C19H18N2O2 |
306.40 g/mol |
CN1C(=CC2=CC=CC=C2)C(=O)NC(C1=O)CC3=CC=CC=C3 |
| 1597 | Diphenylalazine b | C19H18N2O3 |
322.40 g/mol |
CN1C(=CC2=CC=C(C=C2)O)C(=O)NC(C1=O)CC3=CC=CC=C3 |
| 1598 | Dothistromin | C18H12O9 |
372.30 g/mol |
C1C(OC2C1(C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C=CC(=C5C4=O)O)O)O)O |
| 1599 | Drazepinone | C19H19NO2 |
293.40 g/mol |
CC1C=C(C(=O)NC2(C1C3=CC4=CC=CC=C4C=C3O2)C)C |
| 1600 | E-trichoclin | C16H14O5 |
286.28 g/mol |
CC(=CCOC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)CO |