To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 971 | 12,13-dihydroxyfumitremorgin c | C22H25N3O5 |
411.50 g/mol |
CC(=CC1C2=C(C(C3(N1C(=O)C4CCCN4C3=O)O)O)C5=C(N2)C=C(C=C5)OC)C |
| 972 | 12,13-epoxy-9-trichothecene-3,7,8,15-tetrol | C15H22O6 |
298.33 g/mol |
CC1=CC2C(C(C1O)O)(C3(CC(C(C34CO4)O2)O)C)CO |
| 973 | 12,13-epoxytrichothec-9-ene | C15H22O2 |
234.33 g/mol |
CC1=CC2C(CC1)(C3(CCC(C34CO4)O2)C)C |
| 974 | 12beta-hydroxychaetoviridin c | C23H27ClO7 |
450.90 g/mol |
CC(C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)C(C)C(C)O)C)Cl)C(C)O |
| 975 | 13-hydroperoxyoctadecadienoic acid | C18H32O4 |
312.40 g/mol |
CCCCCC(CCCCCCCC=CC=CC(=O)O)OO |
| 976 | 14-dihydroxycornestin | C16H20O6 |
308.33 g/mol |
CCCC1C(C(=O)CC(C(=CC)CC2=C1C(=O)OC2=O)O)O |
| 977 | 14-methoxytajixanthone | C26H28O7 |
452.50 g/mol |
CC1=CC2=C(C3=C1OCC(C3O)C(=C)C)C(=O)C4=C(C=CC(=C4O2)C(C5C(O5)(C)C)OC)O |
| 978 | 14'-hydroxymytoxin b | C29H36O10 |
544.60 g/mol |
CC1=CC2C3(CC1)COC(=O)C=C4CCOC(C4O)(CCC=CC(=O)OC5C3(C6(CO6)C(C5)O2)C)C(=O)CO |
| 979 | 15-deoxyoxalicine a | C30H33NO5 |
487.60 g/mol |
CC1=CCC2C(C13CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)(CCC(C26CCC(=O)OC6)C(=C)C)C |
| 980 | 16-hydroxyroridin e | C29H38O9 |
530.60 g/mol |
CC1=CC(=O)OCC23CCC(=CC2OC4CC(C3(C45CO5)C)OC(=O)C=CC=CC(OCC1)C(C)O)CO |