To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 941 | terrecyclic acid a | C15H20O3 |
248.32 g/mol |
CC1(CC23C(CCC1C2CC(=O)C3=C)C(=O)O)C |
| 942 | trachyspic acid | C20H28O9 |
412.40 g/mol |
CCCCCCCCCC1=COC2(C1=O)CC(C(O2)(CC(=O)O)C(=O)O)C(=O)O |
| 943 | (3alpha,4beta)-4,15-bis(acetyloxy)-12,13-epoxy-3-hydroxytrichothec-9-en-8-one | C19H24O8 |
380.40 g/mol |
CC1=CC2C(CC1=O)(C3(C(C(C(C34CO4)O2)O)OC(=O)C)C)COC(=O)C |
| 944 | (3s,4r)-6-acetyl-3,4-dihydroxy-2,2-dimethylchromane | C13H16O4 |
236.26 g/mol |
CC(=O)C1=CC2=C(C=C1)OC(C(C2O)O)(C)C |
| 945 | (3s,4s)-6-acetyl-3,4-dihydroxy-2,2-dimethylchromane | C13H16O4 |
236.26 g/mol |
CC(=O)C1=CC2=C(C=C1)OC(C(C2O)O)(C)C |
| 946 | (5z)-fusarin c | C23H29NO7 |
431.50 g/mol |
CC=C(C=C(C)C=C(C)C=CC=C(C)C(=O)C12C(O1)C(NC2=O)(CCO)O)C(=O)OC |
| 947 | (7z)-fusarin c | C23H29NO7 |
431.50 g/mol |
CC=C(C=C(C)C=C(C)C=CC=C(C)C(=O)C12C(O1)C(NC2=O)(CCO)O)C(=O)OC |
| 948 | (ar)-2'-methoxyvinaxanthone | C29H18O15 |
606.40 g/mol |
CC(=O)C1=C(C(=C2C(=C1)C(=O)C3=C(O2)C=C(C(=C3C(=O)O)O)O)C(=O)C)C4=C(OC5=C(C4=O)C(=C(C(=C5)O)O)C(=O)O)OC |
| 949 | (e)-2-(4-hydroxyphenyl)-2-oxoacetaldehyde oxime | C8H7NO3 |
165.15 g/mol |
C1=CC(=CC=C1C(=O)C=NO)O |
| 950 | (e)-6-hydroxy-7-(3-methyl-2-butenyl)-2-(3-oxobut-1-enyl)chroman-5-carbaldehyde | C19H22O4 |
314.40 g/mol |
CC(=CCC1=CC2=C(CCC(O2)C=CC(=O)C)C(=C1O)C=O)C |