To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
881 | Vioxanthin | C30H26O10 |
546.50 g/mol |
CC1CC2=C(C(=C3C(=C2)C=C(C(=C3O)C4=C(C5=C(C6=C(CC(OC6=O)C)C=C5C=C4OC)O)O)OC)O)C(=O)O1 |
882 | Viridamine | C16H22N4O2 |
302.37 g/mol |
CC(C)C1C(=O)NC(=CC2=CN=C(N2)CC=C(C)C)C(=O)N1 |
883 | Viridic acid | C24H30N4O5 |
454.50 g/mol |
CC(C)C(C(=O)N(C(=O)CN)C(=O)C1=CC=CC=C1N(C)C)N(C)C2=CC=CC=C2C(=O)O |
884 | Viridicatic acid | C12H16O6 |
256.25 g/mol |
CCCCCC(=O)C1=C(C(OC1=O)CC(=O)O)O |
885 | Viridicatin | C15H11NO2 |
237.25 g/mol |
C1=CC=C(C=C1)C2=C(C(=O)NC3=CC=CC=C32)O |
886 | Viridicatol | C15H11NO3 |
253.25 g/mol |
C1=CC=C2C(=C1)C(=C(C(=O)N2)O)C3=CC(=CC=C3)O |
887 | Viridicatumtoxin | C30H31NO10 |
565.60 g/mol |
CC1=CCCC(C12CC3=C4C2=C(C=C(C4=C(C5=C3C(C6(CC(=O)C(=C(C6(C5=O)O)O)C(=O)N)O)O)O)O)OC)(C)C |
888 | Viridiol | C20H18O6 |
354.40 g/mol |
CC12C(C(C(C3=COC(=C31)C(=O)C4=C2C=CC5=C4CCC5=O)O)OC)O |
889 | Viriditoxin | C34H30O14 |
662.60 g/mol |
COC1=C(C2=C(C(=C1)O)C(=C3C(=C2)CC(OC3=O)CC(=O)OC)O)C4=C(C=C(C5=C4C=C6CC(OC(=O)C6=C5O)CC(=O)OC)O)OC |
890 | Visoltricin | C13H18N2O2 |
234.29 g/mol |
CC(=CCC1=C(N(C=N1)C)C=CC(=O)OC)C |