To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
861 | Verrucine a | C21H20N4O3 |
376.40 g/mol |
C1=CC=C(C=C1)CC2C3=NC4=CC=CC=C4C(=O)N3C(C(=O)N2)CCC(=O)N |
862 | Verrucine b | C21H20N4O3 |
376.40 g/mol |
C1=CC=C(C=C1)CC2C3=NC4=CC=CC=C4C(=O)N3C(C(=O)N2)CCC(=O)N |
863 | Verrucofortine | C24H31N3O3 |
409.50 g/mol |
CC(C)CC1C(=O)N2C(CC3(C2N(C4=CC=CC=C43)C(=O)C)C(C)(C)C=C)C(=O)N1 |
864 | Verrucosidin | C24H32O6 |
416.50 g/mol |
CC1C2(C(O2)C(O1)(C)C=C(C)C=C(C)C3C(O3)(C)C4=C(C(=C(C(=O)O4)C)OC)C)C |
865 | Verruculogen | C27H33N3O7 |
511.60 g/mol |
CC(=CC1N2C3=C(C=CC(=C3)OC)C4=C2C(CC(OO1)(C)C)N5C(=O)C6CCCN6C(=O)C5(C4O)O)C |
866 | Verruculotoxin | C15H20N2O |
244.33 g/mol |
C1CCN2CC(NC(=O)C2C1)CC3=CC=CC=C3 |
867 | Versicolorin a | C18H10O7 |
338.30 g/mol |
C1=COC2C1C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5O)O |
868 | Versicolorin b | C18H12O7 |
340.30 g/mol |
C1COC2C1C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5O)O |
869 | Versicolorin c | C18H12O7 |
340.30 g/mol |
C1COC2C1C3=C(O2)C=C4C(=C3O)C(=O)C5=C(C4=O)C=C(C=C5O)O |
870 | Versicolorone | C20H16O7 |
368.30 g/mol |
CC(=O)CCC1COC2=C1C(=C3C(=C2)C(=O)C4=C(C3=O)C(=CC(=C4)O)O)O |