To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 561 | Malformin b2 | C22H37N5O5S2 |
515.70 g/mol |
CC(C)CC1C(=O)NC2CSSCC(C(=O)NC(C(=O)NC(C(=O)N1)C(C)C)C(C)C)NC2=O |
| 562 | Marcfortine a | C28H35N3O4 |
477.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCCCC7(CC5C4(C)C)C(=O)N6C)C |
| 563 | Marcfortine b | C27H33N3O4 |
463.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCCCC7(CC5C4(C)C)C(=O)N6)C |
| 564 | Marcfortine c | C27H33N3O3 |
447.60 g/mol |
CC1(C=CC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCCCC7(CC5C4(C)C)C(=O)N6)C |
| 565 | Marticin | C18H16O9 |
376.30 g/mol |
CC12CC3=C(C(O1)CC(O2)C(=O)O)C(=C4C(=O)C=C(C(=O)C4=C3O)OC)O |
| 566 | Meleagrin | C23H23N5O4 |
433.50 g/mol |
CC(C)(C=C)C12C=C(C(=O)N3C1(NC(=O)C3=CC4=CN=CN4)N(C5=CC=CC=C25)OC)O |
| 567 | Methylequisetin | C23H33NO4 |
387.50 g/mol |
CC=CC1C(=CC2CC(CCC2C1(C)C(=C3C(=O)C(N(C3=O)C)CO)O)C)C |
| 568 | Methylfunicone | C20H20O8 |
388.40 g/mol |
CC=CC1=C(C(=O)C(=CO1)C(=O)C2=C(C=C(C=C2OC)OC)C(=O)OC)OC |
| 569 | Methysergide | C21H27N3O2 |
353.50 g/mol |
CCC(CO)NC(=O)C1CN(C2CC3=CN(C4=CC=CC(=C34)C2=C1)C)C |
| 570 | Mevinolin | C24H36O5 |
404.50 g/mol |
CCC(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O)C |