To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 541 | Lambertellin | C14H8O5 |
256.21 g/mol |
CC1=CC2=C(C(=O)C3=C(C2=O)C=CC=C3O)OC1=O |
| 542 | Lasiodiplodin | C17H24O4 |
292.40 g/mol |
CC1CCCCCCCC2=C(C(=CC(=C2)O)OC)C(=O)O1 |
| 543 | Lichexanthone | C16H14O5 |
286.28 g/mol |
CC1=CC(=CC2=C1C(=O)C3=C(C=C(C=C3O2)OC)O)OC |
| 544 | Lolitrem a | C42H55NO8 |
701.90 g/mol |
CC1(C2CC3=C(C=CC4=C3C5=C(N4)C6(C(C5)CCC7(C6(CCC8C79C(O9)C3C(O8)C(OC(O3)C3C(O3)(C)C)(C)C)C)O)C)C(=O)C2C(O1)(C)C)C |
| 545 | Lolitrem b | C42H55NO7 |
685.90 g/mol |
CC(=CC1OC2C(C(O1)(C)C)OC3CCC4(C5(C(CCC4(C36C2O6)O)CC7=C5NC8=C7C9=C(C=C8)C(=O)C1C(C9)C(OC1(C)C)(C)C)C)C)C |
| 546 | Lolitrem c | C42H57NO7 |
687.90 g/mol |
CC(C)CC1OC2C(C(O1)(C)C)OC3CCC4(C5(C(CCC4(C36C2O6)O)CC7=C5NC8=C7C9=C(C=C8)C(=O)C1C(C9)C(OC1(C)C)(C)C)C)C |
| 547 | Lolitrem f | C42H55NO7 |
685.90 g/mol |
CC(=CC1OC2C(C(O1)(C)C)OC3CCC4(C5(C(CCC4(C36C2O6)O)CC7=C5NC8=C7C9=C(C=C8)C(=O)C1C(C9)C(OC1(C)C)(C)C)C)C)C |
| 548 | Lolitrem j | C39H51NO8 |
661.80 g/mol |
CC(=O)OC(C)(C)C1C(C2C3(O2)C(O1)CCC4(C3(CCC5C4(C6=C(C5)C7=C(N6)C=CC8=C7CC9C(C8=O)C(OC9(C)C)(C)C)C)O)C)O |
| 549 | Lolitrem k | C37H47NO6 |
601.80 g/mol |
CC(=C)C1C(C2C3(O2)C(O1)CCC4(C3(CCC5C4(C6=C(C5)C7=C(N6)C=CC8=C7CC9C(C8=O)C(OC9(C)C)(C)C)C)O)C)O |
| 550 | Lolitrem n | C37H49NO7 |
619.80 g/mol |
CC1(C2CC3=C(C=CC4=C3C5=C(N4)C6(C(C5)CCC7(C6(CCC8C79C(O9)C(C(O8)C(C)(C)O)O)C)O)C)C(=O)C2C(O1)(C)C)C |