To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 3191 | se-methylselenomethionine | C6H14NO2Se+ |
211.15 g/mol |
C[Se+](C)CCC(C(=O)O)N |
| 3192 | t 2 toxin tetraol | C15H22O6 |
298.33 g/mol |
CC1=CC2C(CC1O)(C3(C(C(C(C34CO4)O2)O)O)C)CO |
| 3193 | tan 1813 | C26H35NO6 |
457.60 g/mol |
CCCCCC(C=C)C1=C(C(=O)NC1=O)C(=O)C2C(C=CC3(C2C(CC(C3)C(=O)O)C)O)C |
| 3194 | tan 931 | C15H10O7 |
302.23 g/mol |
C1=CC(=C(C(=C1)O)C(=O)C2=C(C=C(C=C2O)C(=O)O)C=O)O |
| 3195 | toxin ht 2 | C22H32O8 |
424.50 g/mol |
CC1=CC2C(CC1OC(=O)CC(C)C)(C3(C(C(C(C34CO4)O2)O)O)C)COC(=O)C |
| 3196 | tr-2 | C22H27N3O6 |
429.50 g/mol |
CC(C)(CC1C2=C(C(C3(N1C(=O)C4CCCN4C3=O)O)O)C5=C(N2)C=C(C=C5)OC)O |
| 3197 | triacetylfusarinine c | C39H63FeN6O15+3 |
911.80 g/mol |
CC1=CC(=[OH+])N(CCCC(C(=O)OCCC(=CC(=[OH+])N(CCCC(C(=O)OCCC(=CC(=[OH+])N(CCCC(C(=O)OCC1)NC(=O)C)O)C)NC(=O)C)O)C)NC(=O)C)O.[Fe] |
| 3198 | tryptoquialanine a | C27H26N4O7 |
518.50 g/mol |
CC(C1=NC2=CC=CC=C2C(=O)N1C3CC4(C5N(C6=CC=CC=C64)C(=O)C(N5O)(C)C)OC3=O)OC(=O)C |
| 3199 | varitriol | C15H20O5 |
280.32 g/mol |
CC1C(C(C(O1)C=CC2=C(C(=CC=C2)OC)CO)O)O |
| 3200 | vomitoxin | C15H20O6 |
296.31 g/mol |
CC1=CC2C(C(C1=O)O)(C3(CC(C(C34CO4)O2)O)C)CO |