To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 3181 | paraherquamide | C28H35N3O5 |
493.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCC(C7(CC5C4(C)C)C(=O)N6C)(C)O)C |
| 3182 | penigequinolone b | C27H33NO6 |
467.60 g/mol |
CC1(CCC(OC1)(C)C=CC2=C(C3=C(C=C2)NC(=O)C(C3(C4=CC=C(C=C4)OC)O)OC)O)C |
| 3183 | pf1163b | C27H43NO5 |
461.60 g/mol |
CCCCCC1CCC(CCCCC(=O)N(C(C(=O)O1)CC2=CC=C(C=C2)OCCO)C)C |
| 3184 | pyrenocin a | C11H12O4 |
208.21 g/mol |
CC=CC(=O)C1=C(OC(=O)C=C1OC)C |
| 3185 | q 20547a | C40H36N6O4 |
664.70 g/mol |
C1C2C(=O)NC(C(=O)N2C3C1(C4=CC=CC=C4N3)C56CC7C(=O)NC(C(=O)N7C5NC8=CC=CC=C68)CC9=CC=CC=C9)CC1=CC=CC=C1 |
| 3186 | res 1149-2 | C23H30O5 |
386.50 g/mol |
CC=CC=CC=CC(=O)OC1C=C2COC(=O)C2(C3(C1C(CCC3)(C)C)C)O |
| 3187 | roquefortine | C22H23N5O2 |
389.40 g/mol |
CC(C)(C=C)C12CC3C(=O)NC(=CC4=CN=CN4)C(=O)N3C1NC5=CC=CC=C25 |
| 3188 | roridine e | C29H38O8 |
514.60 g/mol |
CC1=CC2C3(CC1)COC(=O)C=C(CCOC(C=CC=CC(=O)OC4C3(C5(CO5)C(C4)O2)C)C(C)O)C |
| 3189 | selenocysteic acid | C3H7NO5Se |
216.06 g/mol |
C(C(C(=O)O)N)[Se](=O)(=O)O |
| 3190 | selenocysteine | C3H6NO2Se |
167.06 g/mol |
C(C(C(=O)O)N)[Se] |