To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1891 | Melanocin c | C18H14N2O6 |
354.30 g/mol |
C1=CC(=C(C=C1C2=C3C=C(C(=CC3=CC(=C2NC=O)NC=O)O)O)O)O |
| 1892 | Metacytofilin | C16H22N2O4 |
306.36 g/mol |
CC(C)CC1(C(=O)NC(C(=O)O1)(CC2=CC=CC=C2)O)NC |
| 1893 | Methyl asterrate | C18H18O8 |
362.30 g/mol |
CC1=CC(=C(C(=C1)OC2=C(C=C(C=C2OC)O)C(=O)OC)C(=O)OC)O |
| 1894 | Methyl indole-3-acetate | C11H11NO2 |
189.21 g/mol |
COC(=O)CC1=CNC2=CC=CC=C21 |
| 1895 | Methylamine | CH5N |
31.06 g/mol |
CN |
| 1896 | Methylparaben | C8H8O3 |
152.15 g/mol |
COC(=O)C1=CC=C(C=C1)O |
| 1897 | Microperfuranone | C17H14O3 |
266.29 g/mol |
C1=CC=C(C=C1)CC2=C(C(=O)OC2O)C3=CC=CC=C3 |
| 1898 | Militarinone a | C26H37NO6 |
459.60 g/mol |
CCC(C)CC(C)C=C(C)C=CC=CC(=O)C1=C(C(=CN(C1=O)O)C2(CCC(CC2)O)O)O |
| 1899 | Militarinone b | C26H33NO5 |
439.50 g/mol |
CCC(C)CC(C)C=C(C)C=CC=CC(=C1C(=O)C(NC1=O)C(C2=CC=C(C=C2)O)O)O |
| 1900 | Militarinone c | C26H33NO4 |
423.50 g/mol |
CCC(C)CC(C)C=C(C)C=CC=CC(=C1C(=O)C(NC1=O)CC2=CC=C(C=C2)O)O |