To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
1881 | Lumichrome | C12H10N4O2 |
242.23 g/mol |
CC1=CC2=C(C=C1C)N=C3C(=N2)C(=O)NC(=O)N3 |
1882 | Lunatoic acid b | C21H26O7 |
390.40 g/mol |
CCC(C)CC(C)C(=O)OC1C2=COC(=CC2=CC(=O)C1(C)O)C=CC(=O)O |
1883 | Luteusin c | C25H29ClO6 |
460.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C4C(=O)OC(CC4(O3)O)C)C)Cl |
1884 | Luteusin d | C25H29ClO6 |
460.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C4C(=O)OC(CC4(O3)O)C)C)Cl |
1885 | Luteusin e | C25H27ClO6 |
458.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(=C(C(=O)O3)C(=O)CC(C)O)C2=CO1)C)Cl |
1886 | Lysergic acid | C16H16N2O2 |
268.31 g/mol |
CN1CC(C=C2C1CC3=CNC4=CC=CC2=C34)C(=O)O |
1887 | Lysergic acid alpha-hydroxyethylamide | C18H21N3O2 |
311.40 g/mol |
CC(NC(=O)C1CN(C2CC3=CNC4=CC=CC(=C34)C2=C1)C)O |
1888 | M-cymene | C10H14 |
134.22 g/mol |
CC1=CC(=CC=C1)C(C)C |
1889 | Melanocin a | C18H14N2O5 |
338.30 g/mol |
C1=CC(=C(C=C1C=C(C#N)C(=CC2=CC(=C(C=C2)O)O)NC=O)O)O |
1890 | Melanocin b | C17H15NO6 |
329.30 g/mol |
C1=CC(=C(C=C1CC(=O)C(=CC2=CC(=C(C=C2)O)O)NC=O)O)O |