To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 411 | Farnesylemefuranone d | C24H32O5 |
400.50 g/mol |
CC(=CCCC(=CCCC(=CCOC1=C(C=C2C(=C1O)COC2=O)OC)C)C)C |
| 412 | Farnesylemefuranone e | C24H34O6 |
418.50 g/mol |
CC(=CCCC(=CCOC1=C(C=C2C(=C1O)COC2=O)OC)C)CCCC(C)(C)O |
| 413 | Farnesylemefuranone f | C26H36O7 |
460.60 g/mol |
CC(=CCCC(=CCOC1=C(C=C2C(=C1O)COC2=O)OC)C)CCCC(C)(C)OC(=O)C |
| 414 | Fellutanine a | C22H20N4O2 |
372.40 g/mol |
C1=CC=C2C(=C1)C(=CN2)CC3C(=O)NC(C(=O)N3)CC4=CNC5=CC=CC=C54 |
| 415 | Festuclavine | C16H20N2 |
240.34 g/mol |
CC1CC2C(CC3=CNC4=CC=CC2=C34)N(C1)C |
| 416 | Flavacol | C12H20N2O |
208.30 g/mol |
CC(C)CC1=CN=C(C(=O)N1)CC(C)C |
| 417 | Flavoglaucin | C19H28O3 |
304.40 g/mol |
CCCCCCCC1=C(C=C(C(=C1C=O)O)CC=C(C)C)O |
| 418 | Folipastatin | C23H24O5 |
380.40 g/mol |
CC=C(C)C1=CC(=C(C2=C1C(=O)OC3=C(O2)C(=CC(=C3C)O)C(=CC)C)C)O |
| 419 | Fonsecin | C15H14O6 |
290.27 g/mol |
CC1(CC(=O)C2=C(C3=C(C=C(C=C3C=C2O1)O)OC)O)O |
| 420 | Fulvic acid | C14H12O8 |
308.24 g/mol |
CC1(CC2=C(CO1)C(=O)C3=C(O2)C=C(C(=C3C(=O)O)O)O)O |