To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2991 | 2,3-Didehydrogibberellin A9 | C19H22O4 |
314.40 g/mol |
CC12C=CCC3(C1C(C45C3CCC(C4)C(=C)C5)C(=O)O)OC2=O |
| 2992 | 2-(3,5-Dihydroxyphenyl)-6-hydroxybenzofuran | C14H10O4 |
242.23 g/mol |
C1=CC2=C(C=C1O)OC(=C2)C3=CC(=CC(=C3)O)O |
| 2993 | Amphicercosporin | C29H26O10 |
534.50 g/mol |
CC(CC1=C2C3=C4C(=CC(=C5C4=C6C2=C(C(=O)C=C6OCO5)C(=C1OC)O)O)C(=O)C(=C3CC(C)O)OC)O |
| 2994 | Andibenin B | C25H30O6 |
426.50 g/mol |
CC1(C2(CCC34CC5(C=C6C3(COC6=O)C(C5=O)(CC4C2(C)O)C)C)C=CC(=O)O1)C |
| 2995 | Andrastin G | C28H38O8 |
502.60 g/mol |
CC1=C(C2(C(=C)C(C3C(C2(C1=O)C(=O)OC)(CCC4C3(CCC(C4(C)C)OC(=O)C)C=O)C)O)C)O |
| 2996 | RP 1551-2 | C24H31ClO5 |
435.00 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C(C(C2=CO1)CC(=O)CC(C)O)(C)O)Cl |
| 2997 | RP 1551-3 | C25H27ClO5 |
442.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)C=CC)C)Cl |
| 2998 | RP 1551-4 | C25H29ClO6 |
460.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)CC(C)O)C)Cl |
| 2999 | RP 1551-5 | C25H33ClO5 |
449.00 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)CC(O3)(CC(C)O)OC)C)Cl |
| 3000 | RP 1551-6 | C25H29ClO6 |
460.90 g/mol |
CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C4C(=O)OC(CC4(O3)O)C)C)Cl |