To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2941 | Bisabosqual A | C23H28O5 |
384.50 g/mol |
CC(=CCCC1(C2CCC(C3C2C4=C(O1)C=C(C(=C4O3)C=O)C=O)(C)O)C)C |
| 2942 | Bisabosqual B | C23H30O5 |
386.50 g/mol |
CC(=CCCC1(C2CCC(C3C2C4=C(O1)C=C(C(=C4O3)C=O)CO)(C)O)C)C |
| 2943 | Bisabosqual D | C23H30O7 |
418.50 g/mol |
CC1(CCC2C3C1OC4=C(C(=CC(=C34)OC2(C)CCC(C(C)(C)O)O)C=O)C=O)O |
| 2944 | Cyclotryprostatin A | C22H25N3O5 |
411.50 g/mol |
CC(=CC1C2=C(C(C3(N1C(=O)C4CCCN4C3=O)O)O)C5=C(N2)C=C(C=C5)OC)C |
| 2945 | Cyclotryprostatin B | C23H27N3O5 |
425.50 g/mol |
CC(=CC1C2=C(C(C3(N1C(=O)C4CCCN4C3=O)O)OC)C5=C(N2)C=C(C=C5)OC)C |
| 2946 | Cyclotryprostatin C | C21H23N3O4 |
381.40 g/mol |
CC(=CC1C2=C(C(C3(N1C(=O)C4CCCN4C3=O)O)O)C5=CC=CC=C5N2)C |
| 2947 | Epolactaene | C21H27NO6 |
389.40 g/mol |
CC=C(C=C(C)C=CCCC=C(C)C(=O)C12C(O1)C(NC2=O)(C)O)C(=O)OC |
| 2948 | Isorotiorin | C23H28O5 |
384.50 g/mol |
CCC(C)C=C(C)C=CC1=CC2=CC(=O)C3(C(C2CO1)C(C(=O)O3)C(=O)C)C |
| 2949 | Notoamide T | C26H31N3O3 |
433.50 g/mol |
CC(=CCC1=C(C=CC2=C1NC3=C2CC45C(C3(C)C)CC6(CCCN6C4=O)C(=O)N5)O)C |
| 2950 | Phaseic acid | C15H20O5 |
280.32 g/mol |
CC(=CC(=O)O)C=CC1(C2(CC(=O)CC1(OC2)C)C)O |