To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 2051 | Papyracon c | C14H20O5 |
268.30 g/mol |
CC(C=C1CC(C23CC2C(OC3(C1=O)O)(C)C)O)O |
| 2052 | Papyracon d | C14H18O5 |
266.29 g/mol |
CC(=O)CC1=CC(C23CC2C(OC3(C1=O)O)(C)C)O |
| 2053 | Paraherquamide f | C28H35N3O4 |
477.60 g/mol |
CC1(C=CC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCC(C7(CC5C4(C)C)C(=O)N6C)(C)O)C |
| 2054 | Paraherquamide g | C28H35N3O4 |
477.60 g/mol |
CC1(C=CC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCC(C7(CC5C4(C)C)C(=O)N6C)(C)O)C |
| 2055 | Paraherquamide h | C28H33N3O5 |
491.60 g/mol |
CC1CC(=O)N2C13CC4C(C5(CC4(C2)N(C3=O)C)C6=C(C7=C(C=C6)OC(C=CO7)(C)C)NC5=O)(C)C |
| 2056 | Paraherquamide i | C28H31N3O5 |
489.60 g/mol |
CC1=CC(=O)N2C13CC4C(C5(CC4(C2)N(C3=O)C)C6=C(C7=C(C=C6)OC(C=CO7)(C)C)NC5=O)(C)C |
| 2057 | Paraherquamide b | C27H33N3O4 |
463.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCCC7(CC5C4(C)C)C(=O)N6C)C |
| 2058 | Paraherquamide c | C28H33N3O4 |
475.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCC(=C)C7(CC5C4(C)C)C(=O)N6C)C |
| 2059 | Paraherquamide d | C28H33N3O5 |
491.60 g/mol |
CC1(C=COC2=C(O1)C=CC3=C2NC(=O)C34CC56CN7CCC8(C7(CC5C4(C)C)C(=O)N6C)CO8)C |
| 2060 | Parasperone a | C14H10O6 |
274.22 g/mol |
C1=C2C=C3C(=C(C=C(O3)CO)O)C(=C2C(=CC1=O)O)O |