To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 11 | 4-hydroxymellein | C10H10O4 |
194.18 g/mol |
CC1C(C2=C(C(=CC=C2)O)C(=O)O1)O |
| 12 | 4-isoavenaciolide | C15H22O4 |
266.33 g/mol |
CCCCCCCCC1C2C(C(=O)O1)OC(=O)C2=C |
| 13 | 4-o-demethylhypothemycin | C18H20O8 |
364.30 g/mol |
CC1CC=CC(=O)C(C(CC2C(O2)C3=C(C(=CC(=C3)O)O)C(=O)O1)O)O |
| 14 | 4,15-diacetylverrucarol | C19H26O6 |
350.40 g/mol |
CC1=CC2C(CC1)(C3(C(CC(C34CO4)O2)OC(=O)C)C)COC(=O)C |
| 15 | 5-hydroxyculmorin | C15H26O3 |
254.36 g/mol |
CC1(C(CCC2(C3C1C(C2(CC3O)C)O)C)O)C |
| 16 | 5-hydroxymaltol | C6H6O4 |
142.11 g/mol |
CC1=C(C(=O)C(=CO1)O)O |
| 17 | 5-methoxysterigmatocystin | C19H14O7 |
354.30 g/mol |
COC1=C2C(=C(C=C1)O)C(=O)C3=C(C=C4C(=C3O2)C5C=COC5O4)OC |
| 18 | 5-methylbenzene-1,2,3 triol | C7H8O3 |
140.14 g/mol |
CC1=CC(=C(C(=C1)O)O)O |
| 19 | 5-methylmellein | C11H12O3 |
192.21 g/mol |
CC1CC2=C(C=CC(=C2C(=O)O1)O)C |
| 20 | 5'-hydroxyasperentin | C16H20O6 |
308.33 g/mol |
CC1C(CCC(O1)CC2CC3=C(C(=CC(=C3)O)O)C(=O)O2)O |