To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
ID | Name | Formula | Molecular weight | Smiles |
---|---|---|---|---|
1971 | Myrothenone a | C8H9NO3 |
167.16 g/mol |
C=CC1(CC(=CC1=O)NC=O)O |
1972 | Myrothenone b | C7H9NO2 |
139.15 g/mol |
C=CC1(CC(=CC1=O)N)O |
1973 | N-acetylloline | C10H16N2O2 |
196.25 g/mol |
CC(=O)N(C)C1C2CN3C1C(O2)CC3 |
1974 | N-acetylnorloline | C9H14N2O2 |
182.22 g/mol |
CC(=O)NC1C2CN3C1C(O2)CC3 |
1975 | N-formylloline | C9H14N2O2 |
182.22 g/mol |
CN(C=O)C1C2CN3C1C(O2)CC3 |
1976 | N-glucosylmonascorubramine | C29H37NO9 |
543.60 g/mol |
CCCCCCCC(=O)C1=C2C=C3C=C(N(C=C3C(=O)C2(OC1=O)C)C4C(C(C(C(O4)CO)O)O)O)C=CC |
1977 | N-methyl-4-dimethylallyltryptophan | C17H22N2O2 |
286.37 g/mol |
CC(=CCC1=C2C(=CC=C1)NC=C2CC(C(=O)O)NC)C |
1978 | N-methylloline | C9H16N2O |
168.24 g/mol |
CN(C)C1C2CN3C1C(O2)CC3 |
1979 | N-methylsansalvamide | C33H52N4O6 |
600.80 g/mol |
CC(C)CC1C(=O)OC(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)N1)CC2=CC=CC=C2)CC(C)C)C)C(C)C)CC(C)C |
1980 | Neoatroviridin a | C81H142N20O21 |
1732.10 g/mol |
CCC(C)(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)NC(C)(C)C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)CO)NC(=O)CNC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)(C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)CNC(=O)C(C)(C)NC(=O)C |