To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1761 | Glycolaldehyde | C2H4O2 |
60.05 g/mol |
C(C=O)O |
| 1762 | Glyoxalic acid | C2H2O3 |
74.04 g/mol |
C(=O)C(=O)O |
| 1763 | Golmaenone | C19H21N3O4 |
355.40 g/mol |
CC1C(=O)NC(=CC(=O)C2=CC=CC=C2NC(=O)C(C)(C)C=C)C(=O)N1 |
| 1764 | Gossypol | C30H30O8 |
518.60 g/mol |
CC1=CC2=C(C(=C(C(=C2C(C)C)O)O)C=O)C(=C1C3=C(C4=C(C=C3C)C(=C(C(=C4C=O)O)O)C(C)C)O)O |
| 1765 | Guisinol | C23H25ClO5 |
416.90 g/mol |
CC=C(C)C1=CC(=C(C(=C1)OC(=O)C2=C(C(=C(C(=C2O)C)O)Cl)C(=CC)C)C)O |
| 1766 | Haematocin | C24H26N2O6S2 |
502.60 g/mol |
CC(=O)OC1C=CC=C2C1N3C(=O)C4(CC5=CC=CC(C5N4C(=O)C3(C2)SC)OC(=O)C)SC |
| 1767 | Halymecin b | C48H86O19 |
967.20 g/mol |
CCCCCC(CC(CC(=O)OC(CCCCC)CC(CC(=O)OC(CCCCC)CC(CC(=O)OC(CCCCC)CC(CC(=O)O)O)OC(=O)C)O)OC1C(C(C(C(O1)CO)O)O)O)O |
| 1768 | Halymecin c | C32H58O11 |
618.80 g/mol |
CCCCCC(CC(CC(=O)OC(CCCCC)CC(CC(=O)OC(CCCCC)CC(CC(=O)O)O)OC(=O)C)O)O |
| 1769 | Harzianic acid | C19H27NO6 |
365.40 g/mol |
CCCC=CC=CC(=C1C(=O)C(N(C1=O)C)CC(C(C)C)(C(=O)O)O)O |
| 1770 | Harzianin pcu 4 | C68H117N15O17 |
1416.70 g/mol |
CCC(C)C(C(=O)NC(C)(C)C(=O)N1CCCC1C(=O)NC(C)(C)C(=O)NC(CC(C)C)C(=O)NC(C)(C)C(=O)N2CCCC2C(=O)NC(CO)C(C)C)NC(=O)C(CO)NC(=O)C3CCCN3C(=O)C(C)(C)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C(C)(C)NC(=O)C |