To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1691 | Falconensin l | C22H25ClO7 |
436.90 g/mol |
CCCC1=CC2=CC(=O)C(C(C2CO1)O)(C)OC(=O)C3=C(C=C(C(=C3C)Cl)O)OC |
| 1692 | Falconensin m | C22H22Cl2O7 |
469.30 g/mol |
CC=CC1=CC2=CC(=O)C(C(C2CO1)O)(C)OC(=O)C3=C(C(=C(C(=C3OC)Cl)O)Cl)C |
| 1693 | Falconensin n | C22H24Cl2O7 |
471.30 g/mol |
CCCC1=CC2=CC(=O)C(C(C2CO1)O)(C)OC(=O)C3=C(C(=C(C(=C3OC)Cl)O)Cl)C |
| 1694 | Farinosone a | C25H27NO4 |
405.50 g/mol |
CCC(C)C=C(C)C=CC=CC=CC(=O)C1=C(C(=CNC1=O)C2=CC=C(C=C2)O)O |
| 1695 | Farinosone b | C25H27NO5 |
421.50 g/mol |
CCC(C)C=C(C)C=CC=CC=CC(=O)C1=C(C(=CN(C1=O)O)C2=CC=C(C=C2)O)O |
| 1696 | Farinosone c | C19H25NO5 |
347.40 g/mol |
CC(CC(=O)O)C=C(C)C=CC(=O)NC(CC1=CC=C(C=C1)O)CO |
| 1697 | Fellutanine b | C27H28N4O2 |
440.50 g/mol |
CC(C)(C=C)C1=C(C2=CC=CC=C2N1)CC3C(=O)NC(C(=O)N3)CC4=CNC5=CC=CC=C54 |
| 1698 | Fellutanine c | C32H36N4O2 |
508.70 g/mol |
CC(C)(C=C)C1=C(C2=CC=CC=C2N1)CC3C(=O)NC(C(=O)N3)CC4=C(NC5=CC=CC=C54)C(C)(C)C=C |
| 1699 | Fellutanine d | C32H36N4O4 |
540.70 g/mol |
CC(C)(C=C)C12C(CC3N1C(=O)C4CC5(C6=CC=CC=C6NC5(N4C3=O)C(C)(C)C=C)O)(C7=CC=CC=C7N2)O |
| 1700 | Fleephilone | C24H27NO7 |
441.50 g/mol |
CC=CC=CC1=C2C3C(O1)C(CCN3C=C4C2=CC(=O)C(C4=O)(C)OC(=O)CC(C)O)O |