To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1541 | Deacetylchloronectrin | C23H31ClO5 |
422.90 g/mol |
CC1CCC(=O)C(C1(C)CC(C(=CCC2=C(C(=C(C(=C2O)Cl)C)C=O)O)C)O)C |
| 1542 | Deacetylphomoxanthone b | C34H34O14 |
666.60 g/mol |
CC1CC(=O)C2=C(C3=C(C=CC(=C3O)C4=C5C(=C(C=C4)O)C(=C6C(=O)CC(C(C6(O5)CO)OC(=O)C)C)O)OC2(C1OC(=O)C)CO)O |
| 1543 | Decarestrictin j | C10H16O4 |
200.23 g/mol |
CC1CC(CCCC(=O)CC(=O)O1)O |
| 1544 | Decarestrictin n | C10H16O5 |
216.23 g/mol |
CC1CC(C=CC(C(CC(=O)O1)O)O)O |
| 1545 | Decaturin c | C30H35NO5 |
489.60 g/mol |
CC1=CCC2C(C13CC4=C(O3)C=C(OC4=O)C5=CN=CC=C5)(CCC6C27CCC(C6(C)C)(OC7)O)C |
| 1546 | Decaturin d | C30H35NO4 |
473.60 g/mol |
CC1=CCC2C3(CCC(=O)C(C3CCC2(C14CC5=C(O4)C=C(OC5=O)C6=CN=CC=C6)C)(C)C)C |
| 1547 | Dechloroisochromophilone iii | C19H26O4 |
318.40 g/mol |
CCC(C)C=C(C)C=CC1=CC2=CC(=O)C(C(C2CO1)O)(C)O |
| 1548 | Decumbenone a | C16H24O4 |
280.36 g/mol |
CC1CC(C2C(=C1)C=CC(C2(C)C(=O)CCO)(C)O)O |
| 1549 | Decumbenone b | C16H26O4 |
282.37 g/mol |
CC1CC2C=CC(C(C2C(C1)O)(C)C(=O)CCO)(C)O |
| 1550 | Deformylcalbistrin a | C30H40O7 |
512.60 g/mol |
CC1CC(C2C(=C1)C=CC(C2(C)C(=O)C)(C)O)OC(=O)C(C)C(C(=CC=CC(=CC=CC(=O)O)C)C)O |