To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1401 | Chaetomugilin m | C23H27ClO7 |
450.90 g/mol |
CC(C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)C(C)C(C)O)C)Cl)C(C)O |
| 1402 | Chaetomugilin n | C23H25ClO6 |
432.90 g/mol |
CC=C(C)C(=O)C1C2C3=COC(=CC3=C(C(=O)C2(OC1=O)C)Cl)C=CC(C)C(C)O |
| 1403 | Chaetomugilin o | C23H25ClO5 |
416.90 g/mol |
CCC(C)C=CC1=CC2=C(C(=O)C3(C(C2=CO1)C(C(=O)O3)C(=O)C(=CC)C)C)Cl |
| 1404 | Chaetomugilin p | C22H27ClO5 |
406.90 g/mol |
CC=C(C(=O)C(C)(C1CC(=O)C(=C2C1=COC(=C2)C=CC(C)C(C)O)C)O)Cl |
| 1405 | Chaetomugilin q | C22H29ClO6 |
424.90 g/mol |
CC(C=CC1=CC2=C(C(=O)C(C(C2=CO1)CC(=O)C(C)C(C)O)(C)O)Cl)C(C)O |
| 1406 | Chaetomugilin r | C16H21ClO5 |
328.79 g/mol |
CC(C=CC1=CC2=C(C(=O)C(C(C2CO1)O)(C)O)Cl)C(C)O |
| 1407 | Chaetopyranin | C19H24O4 |
316.40 g/mol |
CC(C=CC1CCC2=C(O1)C=C(C(=C2C=O)O)CC=C(C)C)O |
| 1408 | Chaetoquadrin a | C20H24O6 |
360.40 g/mol |
CC1CC(CC2(O1)C(CC3=C(C=C4C(=C3O2)C(=O)C=C(O4)C)OC)C)O |
| 1409 | Chaetoquadrin b | C20H24O6 |
360.40 g/mol |
CC1CC(CC2(O1)C(CC3=C(C=C4C(=C3O2)C(=O)C=C(O4)C)OC)C)O |
| 1410 | Chaetoquadrin c | C20H24O6 |
360.40 g/mol |
CC1CC(CC2(O1)C(CC3=C(C=C4C(=C3O2)C(=O)C=C(O4)C)OC)C)O |