To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1321 | Berkeleyamide a | C18H25NO3 |
303.40 g/mol |
CC(C)CC1CC(C(=O)N1)C(CC(=O)CC2=CC=CC=C2)O |
| 1322 | Berkeleyamide b | C20H21NO6 |
371.40 g/mol |
CC(C)CC(=O)NC(=O)C1=COC(=CC1=O)C(C2=CC=CC=C2)OC(=O)C |
| 1323 | Berkeleyamide c | C22H26N2O6 |
414.50 g/mol |
CC(C)CC(=O)NC(=O)C1=CN(C(=CC1=O)C(C2=CC=CC=C2)OC(=O)C)CCO |
| 1324 | Berkeleyamide d | C18H21NO5 |
331.40 g/mol |
CC(C)CC1(C(C2(C(=O)C=C(O2)CC3=CC=CC=C3)C(=O)N1)O)O |
| 1325 | Berkelic acid | C29H40O9 |
532.60 g/mol |
CCCCCC1CC2=CC(=C(C3=C2C(O1)CC4(O3)C(C(CO4)CC(=O)C(C)(CC)C(=O)OC)C)C(=O)O)O |
| 1326 | Beta-acoradiene | C15H24 |
204.35 g/mol |
CC1CCC(C12CCC(=CC2)C)C(=C)C |
| 1327 | Beta-alanine | C3H7NO2 |
89.09 g/mol |
C(CN)C(=O)O |
| 1328 | Beta-d-glucosamine | C6H13NO5 |
179.17 g/mol |
C(C1C(C(C(C(O1)O)N)O)O)O |
| 1329 | Beta-ergocryptam | C32H41N5O4 |
559.70 g/mol |
CCC(C)C1C(=O)N2CCCC2C(=O)N1C(=O)C(C(C)C)NC(=O)C3CN(C4CC5=CNC6=CC=CC(=C56)C4=C3)C |
| 1330 | Beta-ergocryptine | C32H41N5O5 |
575.70 g/mol |
CCC(C)C1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C(C)C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O |