To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1271 | Atranone g | C25H34O8 |
462.50 g/mol |
CC1=C2C(CC(=O)O2)(C(C(=CCC3C(=C(C(=O)OC3(CC1)C)OC)C(C)C)C)OC(=O)C)O |
| 1272 | Atroviridin c | C94H155N23O24 |
1991.40 g/mol |
CCC(C)(C(=NC(CCC(=N)O)C(=NC(CCC(=N)O)C(=NC(CC1=CC=CC=C1)CO)O)O)O)N=C(C(C)(C)N=C(C(C(C)C)N=C(C2CCCN2C(=O)C(C)(C)N=C(C(CC(C)C)N=C(CN=C(C(C)(C)N=C(C(C(C)C)N=C(C(C)(C)N=C(C(CCC(=N)O)N=C(C(C)(C)N=C(C(C)(C)N=C(C(C)N=C(C(C)(C)N=C(C3CCCN3C(=O)C(C)(C)N=C(C)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O |
| 1273 | Auranticin b | C24H22O8 |
438.40 g/mol |
CC=C(C)C1=CC(=C(C2=C1OC3=C(C(=CC(=C3C=O)O)C(=CC(=O)O)C)C(=O)O2)C)OC |
| 1274 | Aurantiomide a | C19H24N4O4 |
372.40 g/mol |
CC(C)CC1(C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CCC(=O)N)OC |
| 1275 | Aurantiomide b | C18H22N4O4 |
358.40 g/mol |
CC(C)CC1(C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CCC(=O)N)O |
| 1276 | Aurantiomide c | C18H20N4O3 |
340.40 g/mol |
CC(C)C=C1C2=NC3=CC=CC=C3C(=O)N2C(C(=O)N1)CCC(=O)N |
| 1277 | Aurasperone a | C32H26O10 |
570.50 g/mol |
CC1=CC(=O)C2=C(O1)C=C3C=C(C(=C(C3=C2O)OC)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)C=C(O5)C)OC |
| 1278 | Aurasperone b | C32H30O12 |
606.60 g/mol |
CC1(CC(=O)C2=C(O1)C=C3C=C(C(=C(C3=C2O)OC)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)CC(O5)(C)O)OC)O |
| 1279 | Aurasperone c | C31H28O12 |
592.50 g/mol |
CC1(CC(=O)C2=C(C3=C(C(=C(C=C3C=C2O1)O)C4=C5C(=C(C6=C4C=C(C=C6OC)OC)O)C(=O)CC(O5)(C)O)OC)O)O |
| 1280 | Aurasperone d | C31H24O10 |
556.50 g/mol |
CC1=CC(=O)C2=C(O1)C=C3C=C(C(=C(C3=C2O)OC)C4=C5C(=C(C6=C4C=C(C=C6O)OC)O)C(=O)C=C(O5)C)OC |