To download data, it is necessary to get an authorization code sent by email.
Not logged in
Mycotoxin List
| ID | Name | Formula | Molecular weight | Smiles |
|---|---|---|---|---|
| 1111 | Acremonidin d | C33H28O14 |
648.60 g/mol |
CC1=CC(=C(C(=C1CC2=C(C(=C(C=C2C)O)C(=O)C3=C(C=CC(=C3C(=O)OC)O)O)O)O)C(=O)C4=C(C=CC(=C4C(=O)OC)O)O)O |
| 1112 | Acremonidin e | C16H14O7 |
318.28 g/mol |
CC1=CC(=C(C(=C1)O)C(=O)C2=C(C=CC(=C2C(=O)OC)O)O)O |
| 1113 | Acrl toxin ii | C17H24O5 |
308.40 g/mol |
CC=C(C)C(C(C)C=CC(C(C)C1=CC(=CC(=O)O1)O)O)O |
| 1114 | Actg toxin a | C21H32O4 |
348.50 g/mol |
CC(CCC=C(C)C)C1=CCC(C1CC2=C(C(CCC2=O)O)O)(C)O |
| 1115 | Actg toxin b | C21H32O4 |
348.50 g/mol |
CC(=CCC=C(C)C1CCC(C1CC2=C(C(CCC2=O)O)O)(C)O)C |
| 1116 | Actofunicone | C21H22O9 |
418.40 g/mol |
CC(CC1=CC(=O)C(=CO1)C(=O)C2=C(C=C(C=C2OC)OC)C(=O)OC)OC(=O)C |
| 1117 | Aculeacin a | C50H81N7O16 |
1036.20 g/mol |
CCCCCCCCCCCCCCCC(=O)NC1CC(C(NC(=O)C2C(C(CN2C(=O)C(NC(=O)C(NC(=O)C3CC(CN3C(=O)C(NC1=O)C(C)O)O)C(C(C4=CC=C(C=C4)O)O)O)C(C)O)C)O)O)O |
| 1118 | Adenophostin a | C16H26N5O18P3 |
669.30 g/mol |
C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)OC4C(C(C(C(O4)CO)OP(=O)(O)O)OP(=O)(O)O)O)OP(=O)(O)O)N |
| 1119 | Adenophostin b | C18H28N5O19P3 |
711.40 g/mol |
CC(=O)OCC1C(C(C(C(O1)OC2C(OC(C2OP(=O)(O)O)N3C=NC4=C(N=CN=C43)N)CO)O)OP(=O)(O)O)OP(=O)(O)O |
| 1120 | Af 1 | C45H69N13O10 |
952.10 g/mol |
CCC(C)C(C(=O)NC(CCCN=C(N)N)C(=O)NC(CC1=CC=CC=C1)C(=O)N)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CCC(=O)O)NC(=O)C(CC(=O)N)NC(=O)C(CCCCN)N |